The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11alpha-(4-(4-(2-(4-methylpiperazin-1-yl)acetamido)benzoyl)oxy-3,17beta-bis(methoxymethoxy)estra-1,3,5(10)-triene ID: ALA4169602
PubChem CID: 145955331
Max Phase: Preclinical
Molecular Formula: C36H49N3O7
Molecular Weight: 635.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCOc1ccc2c(c1)CC[C@@H]1[C@@H]2[C@H](OC(=O)c2ccc(NC(=O)CN3CCN(C)CC3)cc2)C[C@]2(C)[C@@H](OCOC)CC[C@@H]12
Standard InChI: InChI=1S/C36H49N3O7/c1-36-20-31(46-35(41)24-5-8-26(9-6-24)37-33(40)21-39-17-15-38(2)16-18-39)34-28-12-10-27(44-22-42-3)19-25(28)7-11-29(34)30(36)13-14-32(36)45-23-43-4/h5-6,8-10,12,19,29-32,34H,7,11,13-18,20-23H2,1-4H3,(H,37,40)/t29-,30-,31+,32-,34+,36-/m0/s1
Standard InChI Key: LIHWVDAMULPTPM-KSTOOANQSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
19.5796 -8.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5713 -8.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8614 -9.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1557 -8.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4499 -9.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4417 -10.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8738 -7.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1598 -8.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8656 -10.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3472 -9.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7359 -8.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3596 -7.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1557 -10.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7442 -10.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8343 -8.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0302 -10.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0302 -9.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5713 -7.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6114 -7.0906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3244 -10.5616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8532 -8.5186 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.1474 -9.7403 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.5713 -9.7444 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.4539 -7.6941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4575 -6.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7517 -6.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1671 -6.4715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7573 -5.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0522 -5.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3417 -5.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3407 -6.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0464 -6.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6353 -5.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6378 -4.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9314 -4.0040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3468 -4.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3494 -3.1913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4104 -6.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6162 -10.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0633 -2.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0678 -1.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3632 -1.5563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6524 -1.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6462 -2.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3688 -0.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9090 -10.5633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2008 -10.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6614 -6.1414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4604 -5.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
5 4 1 0
6 5 2 0
7 1 1 0
8 7 1 0
9 3 1 0
10 2 1 0
11 5 1 0
12 1 1 0
13 9 1 0
14 6 1 0
15 12 1 0
16 17 1 0
17 11 2 0
1 18 1 1
12 19 1 1
20 16 1 0
3 21 1 1
4 22 1 6
2 23 1 6
10 15 1 0
3 4 1 0
6 13 1 0
14 16 2 0
8 24 1 6
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
19 38 1 0
20 39 1 0
37 40 1 0
37 44 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
42 45 1 0
39 46 1 0
46 47 1 0
38 48 1 0
48 49 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.80Molecular Weight (Monoisotopic): 635.3571AlogP: 4.54#Rotatable Bonds: 11Polar Surface Area: 98.80Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.81CX Basic pKa: 7.21CX LogP: 4.82CX LogD: 4.61Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.28Np Likeness Score: 0.23
References 1. Lao K, Wang Y, Chen M, Zhang J, You Q, Xiang H.. (2017) Design, synthesis and biological evaluation of novel 2-methoxyestradiol analogs as dual selective estrogen receptor modulators (SERMs) and antiangiogenic agents., 139 [PMID:28810190 ] [10.1016/j.ejmech.2017.08.016 ]