3-Dibenzofuran-4-yl-N-[2-(3-fluoro-phenyl)-ethyl]-5-trifluoromethyl-benzenesulfonamide

ID: ALA4169644

PubChem CID: 145953276

Max Phase: Preclinical

Molecular Formula: C27H19F4NO3S

Molecular Weight: 513.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2cccc3c2oc2ccccc23)cc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C27H19F4NO3S/c28-20-6-3-5-17(13-20)11-12-32-36(33,34)21-15-18(14-19(16-21)27(29,30)31)22-8-4-9-24-23-7-1-2-10-25(23)35-26(22)24/h1-10,13-16,32H,11-12H2

Standard InChI Key:  WJUNCQQUENYRLK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   13.1925  -24.5180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0180  -24.5221    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.6068  -23.8045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3114  -25.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3102  -26.5905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0260  -27.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7435  -26.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7406  -25.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0242  -25.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5944  -27.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8791  -26.5894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.5937  -27.8303    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8732  -27.4096    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.7361  -24.1090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4487  -24.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1629  -24.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8797  -24.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8802  -25.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5961  -25.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3114  -25.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3063  -24.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5898  -24.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5981  -26.5746    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.4520  -27.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8831  -27.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8792  -26.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1632  -26.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1673  -28.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4539  -27.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8477  -28.3849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9992  -29.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1838  -29.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8547  -29.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3359  -30.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1540  -30.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4835  -29.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
  9  2  1  0
  2 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 19 23  1  0
 24 29  2  0
 28 25  2  0
 25 26  1  0
 26 27  2  0
 27 24  1  0
  7 24  1  0
 28 29  1  0
 29 30  1  0
 30 32  1  0
 31 28  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4169644

    ---

Associated Targets(Human)

ERBB4 Tclin Receptor protein-tyrosine kinase erbB-4 (2748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDPK1 Tchem 3-phosphoinositide dependent protein kinase-1 (3758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EPHA3 Tchem Ephrin type-A receptor 3 (1582 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.51Molecular Weight (Monoisotopic): 513.1022AlogP: 6.93#Rotatable Bonds: 6
Polar Surface Area: 59.31Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.87CX Basic pKa: CX LogP: 6.66CX LogD: 6.66
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.09

References

1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S..  (2018)  Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening.,  152  [PMID:29730188] [10.1016/j.ejmech.2018.04.018]

Source