The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Dibenzofuran-4-yl-N-[2-(3-fluoro-phenyl)-ethyl]-5-trifluoromethyl-benzenesulfonamide ID: ALA4169644
PubChem CID: 145953276
Max Phase: Preclinical
Molecular Formula: C27H19F4NO3S
Molecular Weight: 513.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2cccc3c2oc2ccccc23)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C27H19F4NO3S/c28-20-6-3-5-17(13-20)11-12-32-36(33,34)21-15-18(14-19(16-21)27(29,30)31)22-8-4-9-24-23-7-1-2-10-25(23)35-26(22)24/h1-10,13-16,32H,11-12H2
Standard InChI Key: WJUNCQQUENYRLK-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
13.1925 -24.5180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0180 -24.5221 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.6068 -23.8045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3114 -25.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3102 -26.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0260 -27.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7435 -26.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7406 -25.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0242 -25.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5944 -27.0048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8791 -26.5894 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5937 -27.8303 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8732 -27.4096 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7361 -24.1090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4487 -24.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1629 -24.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8797 -24.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8802 -25.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5961 -25.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3114 -25.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3063 -24.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5898 -24.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5981 -26.5746 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.4520 -27.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8831 -27.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8792 -26.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1632 -26.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1673 -28.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4539 -27.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8477 -28.3849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9992 -29.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1838 -29.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8547 -29.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3359 -30.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1540 -30.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4835 -29.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
9 2 1 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
24 29 2 0
28 25 2 0
25 26 1 0
26 27 2 0
27 24 1 0
7 24 1 0
28 29 1 0
29 30 1 0
30 32 1 0
31 28 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.51Molecular Weight (Monoisotopic): 513.1022AlogP: 6.93#Rotatable Bonds: 6Polar Surface Area: 59.31Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.87CX Basic pKa: ┄CX LogP: 6.66CX LogD: 6.66Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.09
References 1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S.. (2018) Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening., 152 [PMID:29730188 ] [10.1016/j.ejmech.2018.04.018 ]