The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-methylbenzyl)-3-(1-((2-(morpholinoamino)pyridin-4-yl)oxy)ethyl)benzamide ID: ALA4170026
PubChem CID: 141482502
Max Phase: Preclinical
Molecular Formula: C26H30N4O3
Molecular Weight: 446.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(CNC(=O)c2cccc(C(C)Oc3ccnc(NN4CCOCC4)c3)c2)cc1
Standard InChI: InChI=1S/C26H30N4O3/c1-19-6-8-21(9-7-19)18-28-26(31)23-5-3-4-22(16-23)20(2)33-24-10-11-27-25(17-24)29-30-12-14-32-15-13-30/h3-11,16-17,20H,12-15,18H2,1-2H3,(H,27,29)(H,28,31)
Standard InChI Key: WSVHAALEDZEQMN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.8243 -22.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8232 -23.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5353 -23.9076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2491 -23.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2463 -22.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5335 -22.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9616 -23.9056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9629 -24.7269 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5311 -21.4448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2376 -21.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2352 -20.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9465 -21.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9468 -22.2551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6549 -22.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3623 -22.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3573 -21.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6486 -21.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0623 -21.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7727 -21.4201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0570 -20.1990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7780 -22.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4883 -22.6413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4908 -23.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2003 -23.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9064 -23.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8984 -22.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1883 -22.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6172 -23.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2493 -25.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2486 -25.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9587 -26.3650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6711 -25.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6735 -25.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
8 29 1 0
8 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2318AlogP: 4.12#Rotatable Bonds: 8Polar Surface Area: 75.72Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 12.79CX LogP: 3.98CX LogD: 2.49Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.37
References 1. Tian Y, Zhang T, Long L, Li Z, Wan S, Wang G, Yu Y, Hou J, Wu X, Zhang J.. (2018) Design, synthesis, biological evaluation and molecular modeling of novel 2-amino-4-(1-phenylethoxy) pyridine derivatives as potential ROS1 inhibitors., 143 [PMID:29174814 ] [10.1016/j.ejmech.2017.11.002 ]