2-(1,1-Dioxido-2,3-dihydro-1,4-benzothiazepin-4(5H)-yl)-6-methyl-N-[2-(morpholin-4-yl)ethyl]quinolin-4-amine

ID: ALA4170204

PubChem CID: 145953958

Max Phase: Preclinical

Molecular Formula: C26H31FN4O

Molecular Weight: 434.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N3CCCc4ccc(F)cc4C3)cc(NCCN3CCOCC3)c2c1

Standard InChI:  InChI=1S/C26H31FN4O/c1-19-4-7-24-23(15-19)25(28-8-10-30-11-13-32-14-12-30)17-26(29-24)31-9-2-3-20-5-6-22(27)16-21(20)18-31/h4-7,15-17H,2-3,8-14,18H2,1H3,(H,28,29)

Standard InChI Key:  ARCMBWUUXXJWPT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   27.3674   -5.2236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0770   -4.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0742   -3.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3656   -3.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6593   -4.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6616   -3.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9557   -3.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2470   -3.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2487   -4.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9552   -5.2216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7854   -5.2217    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3621   -2.7691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0680   -2.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7775   -2.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4835   -2.3514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4533   -4.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7224   -6.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3246   -6.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1328   -6.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2340   -4.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5407   -5.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3490   -5.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8516   -5.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5401   -4.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7327   -4.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5392   -3.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0397   -3.8183    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.1885   -2.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8923   -2.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8930   -1.5343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1837   -1.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4737   -1.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  2 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 11 16  1  0
 16 20  1  0
 11 17  1  0
 17 18  1  0
 21 19  1  0
 18 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  8 26  1  0
 24 27  1  0
 15 28  1  0
 15 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4170204

    ---

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

F Fusion glycoprotein F0 (242 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.56Molecular Weight (Monoisotopic): 434.2482AlogP: 4.38#Rotatable Bonds: 5
Polar Surface Area: 40.63Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.28CX LogP: 4.97CX LogD: 3.30
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -1.89

References

1. Zheng X, Liang C, Wang L, Wang B, Liu Y, Feng S, Wu JZ, Gao L, Feng L, Chen L, Guo T, Shen HC, Yun H..  (2018)  Discovery of Benzoazepinequinoline (BAQ) Derivatives as Novel, Potent, Orally Bioavailable Respiratory Syncytial Virus Fusion Inhibitors.,  61  (22): [PMID:30339388] [10.1021/acs.jmedchem.8b01394]

Source