The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl N-[(3beta,17beta-dihydroxy-5alpha-androstan-17alpha-yl)methyl]carbamate ID: ALA4170304
PubChem CID: 145955597
Max Phase: Preclinical
Molecular Formula: C22H37NO4
Molecular Weight: 379.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)NC[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C
Standard InChI: InChI=1S/C22H37NO4/c1-20-9-6-15(24)12-14(20)4-5-16-17(20)7-10-21(2)18(16)8-11-22(21,26)13-23-19(25)27-3/h14-18,24,26H,4-13H2,1-3H3,(H,23,25)/t14-,15-,16+,17-,18-,20-,21-,22+/m0/s1
Standard InChI Key: LZIBFKUCRZFDCI-KRXHPCMFSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
27.5369 -2.5919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5410 -3.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2466 -2.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2074 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2074 -5.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9168 -6.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9168 -4.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6221 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6186 -5.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3248 -6.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0390 -5.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3318 -4.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0386 -4.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0553 -3.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3370 -3.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7621 -3.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7533 -4.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5286 -4.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0183 -4.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4962 -6.1011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6148 -4.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0304 -4.0529 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.7568 -2.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6107 -6.5045 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.3247 -5.2787 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.7486 -5.2952 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.9564 -3.4019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6620 -2.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3718 -3.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6579 -2.1726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3635 -1.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
4 5 1 0
4 7 1 0
5 6 1 0
6 9 1 0
8 7 1 0
8 9 1 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 15 1 0
13 17 1 0
16 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 2 1 0
2 16 1 0
5 20 1 1
8 21 1 1
13 22 1 1
16 23 1 1
9 24 1 6
12 25 1 6
17 26 1 6
3 27 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.54Molecular Weight (Monoisotopic): 379.2723AlogP: 3.48#Rotatable Bonds: 2Polar Surface Area: 78.79Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.92CX Basic pKa: ┄CX LogP: 2.77CX LogD: 2.77Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.69Np Likeness Score: 1.79
References 1. Romero-Hernández LL, Merino-Montiel P, Meza-Reyes S, Vega-Baez JL, López Ó, Padrón JM, Montiel-Smith S.. (2018) Synthesis of unprecedented steroidal spiro heterocycles as potential antiproliferative drugs., 143 [PMID:29172080 ] [10.1016/j.ejmech.2017.10.063 ]