The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3-((4-Chlorobenzyl)oxy)benzylidene)-2-((4-chlorobenzyl)thio)-3,5-dihydro-4H-imidazole-4-one ID: ALA4170355
PubChem CID: 145955833
Max Phase: Preclinical
Molecular Formula: C24H18Cl2N2O2S
Molecular Weight: 469.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(SCc2ccc(Cl)cc2)=N/C1=C\c1cccc(OCc2ccc(Cl)cc2)c1
Standard InChI: InChI=1S/C24H18Cl2N2O2S/c25-19-8-4-16(5-9-19)14-30-21-3-1-2-18(12-21)13-22-23(29)28-24(27-22)31-15-17-6-10-20(26)11-7-17/h1-13H,14-15H2,(H,27,28,29)/b22-13-
Standard InChI Key: QAEUIFPDAOXNND-XKZIYDEJSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.5010 -16.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3206 -16.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7275 -15.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3201 -14.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4975 -14.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0901 -15.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5488 -15.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9614 -16.3086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7827 -16.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1878 -17.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0084 -17.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4221 -16.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0051 -15.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1859 -15.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4155 -14.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2368 -14.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7181 -15.5399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7138 -14.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4960 -14.4635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4966 -15.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2032 -15.6920 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4573 -13.4336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2688 -15.6007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.2023 -16.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9096 -16.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9046 -17.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6110 -18.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3202 -17.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3185 -16.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6114 -16.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0280 -18.1456 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 20 2 0
19 18 1 0
18 16 1 0
19 20 1 0
20 21 1 0
18 22 2 0
6 23 1 0
21 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.39Molecular Weight (Monoisotopic): 468.0466AlogP: 6.33#Rotatable Bonds: 6Polar Surface Area: 50.69Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.75CX Basic pKa: ┄CX LogP: 6.79CX LogD: 6.79Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.05
References 1. Schoeder CT, Kaleta M, Mahardhika AB, Olejarz-Maciej A, Łażewska D, Kieć-Kononowicz K, Müller CE.. (2018) Structure-activity relationships of imidazothiazinones and analogs as antagonists of the cannabinoid-activated orphan G protein-coupled receptor GPR18., 155 [PMID:29902723 ] [10.1016/j.ejmech.2018.05.050 ]