The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11alpha-(4-(4-(pyrrolidin-1-yl)acetamido)benzoyl)oxy-3,17beta-bis(methoxymethoxy)estra-1,3,5(10)-triene ID: ALA4171149
PubChem CID: 145950699
Max Phase: Preclinical
Molecular Formula: C35H46N2O7
Molecular Weight: 606.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCOc1ccc2c(c1)CC[C@@H]1[C@@H]2[C@H](OC(=O)c2ccc(NC(=O)CN3CCCC3)cc2)C[C@]2(C)[C@@H](OCOC)CC[C@@H]12
Standard InChI: InChI=1S/C35H46N2O7/c1-35-19-30(44-34(39)23-6-9-25(10-7-23)36-32(38)20-37-16-4-5-17-37)33-27-13-11-26(42-21-40-2)18-24(27)8-12-28(33)29(35)14-15-31(35)43-22-41-3/h6-7,9-11,13,18,28-31,33H,4-5,8,12,14-17,19-22H2,1-3H3,(H,36,38)/t28-,29-,30+,31-,33+,35-/m0/s1
Standard InChI Key: WITQSQHOZSBNHA-MGICSCBLSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
8.3824 -20.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3741 -21.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6643 -21.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9585 -21.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2528 -21.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2445 -22.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6766 -20.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9626 -20.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6684 -22.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1501 -21.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5387 -21.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1624 -20.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9585 -22.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5470 -22.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6371 -20.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8330 -22.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8330 -21.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3741 -19.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4142 -19.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1272 -22.9185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6560 -20.8755 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9503 -22.0972 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.3741 -22.1013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.2567 -20.0511 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2604 -19.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5545 -18.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9699 -18.8284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5601 -18.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8551 -17.5942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1446 -17.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1435 -18.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8492 -19.2291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4381 -17.5889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4407 -16.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7342 -16.3610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1496 -16.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1522 -15.5482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4190 -22.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2132 -19.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8177 -15.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5676 -14.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7503 -14.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4955 -15.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7118 -22.9202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0036 -22.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4642 -18.4983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2632 -18.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
5 4 1 0
6 5 2 0
7 1 1 0
8 7 1 0
9 3 1 0
10 2 1 0
11 5 1 0
12 1 1 0
13 9 1 0
14 6 1 0
15 12 1 0
16 17 1 0
17 11 2 0
1 18 1 1
12 19 1 1
20 16 1 0
3 21 1 1
4 22 1 6
2 23 1 6
10 15 1 0
3 4 1 0
6 13 1 0
14 16 2 0
8 24 1 6
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
20 38 1 0
19 39 1 0
37 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 37 1 0
38 44 1 0
44 45 1 0
39 46 1 0
46 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 606.76Molecular Weight (Monoisotopic): 606.3305AlogP: 5.38#Rotatable Bonds: 11Polar Surface Area: 95.56Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.81CX Basic pKa: 7.27CX LogP: 5.38CX LogD: 5.14Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.27Np Likeness Score: 0.31
References 1. Lao K, Wang Y, Chen M, Zhang J, You Q, Xiang H.. (2017) Design, synthesis and biological evaluation of novel 2-methoxyestradiol analogs as dual selective estrogen receptor modulators (SERMs) and antiangiogenic agents., 139 [PMID:28810190 ] [10.1016/j.ejmech.2017.08.016 ]