The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{2-[5-(4-dimethylaminophenyl)-3-phenyl-4,5-dihydropyrazol-1-yl]-4-oxo-4,5-dihydro-1,3-thiazol-5-ylidene}-2,3-dihydro-1H-indol-2-one ID: ALA4171287
Max Phase: Preclinical
Molecular Formula: C28H23N5O2S
Molecular Weight: 493.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C2CC(c3ccccc3)=NN2C2=NC(=O)/C(=C3/C(=O)Nc4ccccc43)S2)cc1
Standard InChI: InChI=1S/C28H23N5O2S/c1-32(2)19-14-12-18(13-15-19)23-16-22(17-8-4-3-5-9-17)31-33(23)28-30-27(35)25(36-28)24-20-10-6-7-11-21(20)29-26(24)34/h3-15,23H,16H2,1-2H3,(H,29,34)/b25-24-
Standard InChI Key: XFQIZGJQGGVATP-IZHYLOQSSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
35.3366 -8.0337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1619 -8.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4189 -7.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0838 -7.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7493 -6.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6621 -5.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9102 -5.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2446 -6.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3351 -6.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6464 -8.7021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2040 -6.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8673 -7.4781 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.5350 -6.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2799 -6.2076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4544 -6.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9672 -5.5415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3202 -7.2477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5722 -8.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3977 -8.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6528 -7.2458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9848 -6.7609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.4377 -6.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0465 -7.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8309 -7.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0029 -6.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3844 -5.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6024 -6.1864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0862 -8.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2664 -8.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7806 -9.2728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1152 -10.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9406 -10.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4228 -9.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6300 -10.6962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8090 -10.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9657 -11.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 5 1 0
4 1 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
2 10 2 0
3 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
15 16 2 0
13 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
18 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.59Molecular Weight (Monoisotopic): 493.1572AlogP: 4.90#Rotatable Bonds: 3Polar Surface Area: 77.37Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.03CX Basic pKa: 4.83CX LogP: 4.40CX LogD: 4.40Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.53Np Likeness Score: -1.08
References 1. Szychowski KA, Leja ML, Kaminskyy DV, Kryshchyshyn AP, Binduga UE, Pinyazhko OR, Lesyk RB, Tobiasz J, Gmiński J.. (2017) Anticancer properties of 4-thiazolidinone derivatives depend on peroxisome proliferator-activated receptor gamma (PPARγ)., 141 [PMID:29031063 ] [10.1016/j.ejmech.2017.09.071 ]