1-(4-(2-methoxy-4-methylphenoxy)-2-((4-morpholinophenyl)amino)pyrimidin-5-yl)-3-(2-methoxyphenyl)urea

ID: ALA4171406

PubChem CID: 142749655

Max Phase: Preclinical

Molecular Formula: C30H32N6O5

Molecular Weight: 556.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1NC(=O)Nc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Oc1ccc(C)cc1OC

Standard InChI:  InChI=1S/C30H32N6O5/c1-20-8-13-26(27(18-20)39-3)41-28-24(34-30(37)33-23-6-4-5-7-25(23)38-2)19-31-29(35-28)32-21-9-11-22(12-10-21)36-14-16-40-17-15-36/h4-13,18-19H,14-17H2,1-3H3,(H,31,32,35)(H2,33,34,37)

Standard InChI Key:  NRTJYFLABQKQBZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    7.3079   -6.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3068   -7.0227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0148   -7.4317    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7245   -7.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7216   -6.1996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0130   -5.7943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0106   -4.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7171   -4.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4239   -4.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1299   -4.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1279   -3.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4140   -3.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7109   -3.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4328   -7.4297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1399   -7.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8449   -7.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5515   -7.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5506   -6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8373   -5.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1337   -6.2049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0003   -3.3498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9944   -2.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8338   -3.3356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2516   -5.7914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9604   -6.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6648   -5.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6667   -4.9754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9579   -4.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2473   -4.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6001   -5.7948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8925   -6.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1847   -5.7951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8927   -7.0207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4771   -6.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7698   -5.7937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -6.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0624   -7.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7752   -7.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4794   -7.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7707   -4.9765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0634   -4.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  1  0
 21 22  1  0
 11 23  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 18 24  1  0
  1 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 35 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4171406

    ---

Associated Targets(Human)

LCK Tclin Tyrosine-protein kinase LCK (9212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.62Molecular Weight (Monoisotopic): 556.2434AlogP: 5.82#Rotatable Bonds: 9
Polar Surface Area: 119.10Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3
CX Acidic pKa: 10.27CX Basic pKa: 2.97CX LogP: 5.50CX LogD: 5.50
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -1.47

References

1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ..  (2017)  Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders.,  141  [PMID:29107425] [10.1016/j.ejmech.2017.10.003]

Source