The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Prop-2-yn-1-yl-2-Amino-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-6-(2-(trifluoromethyl)pyridin-4-yl)-4H-chromene-3-carboxylate ID: ALA4171517
PubChem CID: 145950276
Max Phase: Preclinical
Molecular Formula: C24H17F3N2O5
Molecular Weight: 470.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(C(F)(F)F)c3)cc21
Standard InChI: InChI=1S/C24H17F3N2O5/c1-3-9-32-20(30)13-17-16-11-14(15-7-8-29-19(12-15)24(25,26)27)5-6-18(16)34-22(28)21(17)23(31)33-10-4-2/h1-2,5-8,11-12,17H,9-10,13,28H2
Standard InChI Key: PVPLASDMLQNVAQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.4277 -20.0624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4265 -20.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1414 -21.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8579 -20.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8549 -20.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1396 -19.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5729 -21.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5693 -22.1261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2837 -22.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2796 -20.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9945 -21.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9956 -22.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7076 -22.5303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4231 -22.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4220 -21.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7054 -20.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1376 -22.5311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1364 -20.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8509 -21.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1361 -20.0548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5653 -20.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5650 -20.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5648 -19.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7032 -20.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9875 -19.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9853 -18.8176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2743 -20.0570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6987 -18.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4142 -18.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1299 -19.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7118 -21.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9976 -20.8887 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.7112 -22.1267 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9916 -21.7083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
14 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 3 0
16 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 3 0
2 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.40Molecular Weight (Monoisotopic): 470.1090AlogP: 3.16#Rotatable Bonds: 6Polar Surface Area: 100.74Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.53CX LogP: 3.47CX LogD: 3.47Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -0.53
References 1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C.. (2018) Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells., 61 (15): [PMID:29995404 ] [10.1021/acs.jmedchem.8b00813 ]