Prop-2-yn-1-yl-2-Amino-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-6-(2-(trifluoromethyl)pyridin-4-yl)-4H-chromene-3-carboxylate

ID: ALA4171517

PubChem CID: 145950276

Max Phase: Preclinical

Molecular Formula: C24H17F3N2O5

Molecular Weight: 470.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(C(F)(F)F)c3)cc21

Standard InChI:  InChI=1S/C24H17F3N2O5/c1-3-9-32-20(30)13-17-16-11-14(15-7-8-29-19(12-15)24(25,26)27)5-6-18(16)34-22(28)21(17)23(31)33-10-4-2/h1-2,5-8,11-12,17H,9-10,13,28H2

Standard InChI Key:  PVPLASDMLQNVAQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    3.4277  -20.0624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4265  -20.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1414  -21.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8579  -20.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8549  -20.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1396  -19.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5729  -21.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5693  -22.1261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2837  -22.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2796  -20.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9945  -21.2944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9956  -22.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7076  -22.5303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4231  -22.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4220  -21.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7054  -20.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1376  -22.5311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1364  -20.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8509  -21.2921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1361  -20.0548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5653  -20.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5650  -20.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5648  -19.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7032  -20.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875  -19.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9853  -18.8176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2743  -20.0570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6987  -18.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4142  -18.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1299  -19.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7118  -21.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9976  -20.8887    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.7112  -22.1267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9916  -21.7083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 14 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  3  0
 16 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  3  0
  2 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4171517

    ---

Associated Targets(Human)

HL60/MX2 (68 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.40Molecular Weight (Monoisotopic): 470.1090AlogP: 3.16#Rotatable Bonds: 6
Polar Surface Area: 100.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.53CX LogP: 3.47CX LogD: 3.47
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -0.53

References

1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C..  (2018)  Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells.,  61  (15): [PMID:29995404] [10.1021/acs.jmedchem.8b00813]

Source