N5-(4-chlorobenzyl)-4-(2-methoxy-4-methylphenoxy)-N2-(4-morpholinophenyl)pyrimidine-2,5-diamine

ID: ALA4171753

PubChem CID: 145950509

Max Phase: Preclinical

Molecular Formula: C29H30ClN5O3

Molecular Weight: 532.04

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C)ccc1Oc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1NCc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C29H30ClN5O3/c1-20-3-12-26(27(17-20)36-2)38-28-25(31-18-21-4-6-22(30)7-5-21)19-32-29(34-28)33-23-8-10-24(11-9-23)35-13-15-37-16-14-35/h3-12,17,19,31H,13-16,18H2,1-2H3,(H,32,33,34)

Standard InChI Key:  PDUIEOQZZUMNNL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   20.3211   -4.2180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3199   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0280   -5.4465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7376   -5.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7348   -4.2144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0262   -3.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0237   -2.9919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7302   -2.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4370   -2.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1430   -2.5801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1410   -1.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4271   -1.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7241   -1.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4460   -5.4445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1530   -5.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8581   -5.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5646   -5.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5638   -4.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8505   -3.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1468   -4.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6132   -3.8096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9056   -4.2183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2001   -3.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2013   -2.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4943   -2.5838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7857   -2.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7885   -3.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4961   -4.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8470   -1.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0134   -1.3646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0075   -0.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2648   -3.8062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9735   -4.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6780   -3.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6798   -2.9902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9711   -2.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2605   -2.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0774   -2.5851    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  1 21  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 23  1  0
 11 29  1  0
 13 30  1  0
 30 31  1  0
 32 33  1  0
 32 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 18 32  1  0
 26 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4171753

    ---

Associated Targets(Human)

LCK Tclin Tyrosine-protein kinase LCK (9212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.04Molecular Weight (Monoisotopic): 531.2037AlogP: 6.43#Rotatable Bonds: 9
Polar Surface Area: 80.77Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.12CX LogP: 6.31CX LogD: 6.31
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.49

References

1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ..  (2017)  Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders.,  141  [PMID:29107425] [10.1016/j.ejmech.2017.10.003]

Source