(E)-5-((3,5-dimethoxybenzylidene)amino)-4-(3-methoxyphenoxy)-N-(4-morpholinophenyl)pyrimidin-2-amine

ID: ALA4172190

PubChem CID: 137365221

Max Phase: Preclinical

Molecular Formula: C30H31N5O5

Molecular Weight: 541.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=N/c2cnc(Nc3ccc(N4CCOCC4)cc3)nc2Oc2cccc(OC)c2)cc(OC)c1

Standard InChI:  InChI=1S/C30H31N5O5/c1-36-24-5-4-6-25(17-24)40-29-28(31-19-21-15-26(37-2)18-27(16-21)38-3)20-32-30(34-29)33-22-7-9-23(10-8-22)35-11-13-39-14-12-35/h4-10,15-20H,11-14H2,1-3H3,(H,32,33,34)/b31-19+

Standard InChI Key:  SWBPCPSLZCXUEC-ZCTHSVRISA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   32.2281  -13.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2270  -14.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9350  -14.4562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6447  -14.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6418  -13.2241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9332  -12.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9308  -12.0017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6373  -11.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3441  -11.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0501  -11.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0481  -10.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3342  -10.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6311  -10.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3530  -14.4543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0601  -14.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7651  -14.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4717  -14.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4709  -13.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7575  -12.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0539  -13.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5203  -12.8193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8127  -13.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1072  -12.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1083  -12.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4014  -11.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6928  -12.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6956  -12.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4031  -13.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1719  -12.8159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8806  -13.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5850  -12.8175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5869  -11.9999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8781  -11.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1675  -12.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3289   -9.5483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0339   -9.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9894  -13.2350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2802  -12.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4016  -10.7763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6939  -10.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  1 21  1  0
 21 22  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 23  1  0
 29 30  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 18 29  1  0
 12 35  1  0
 35 36  1  0
 27 37  1  0
 37 38  1  0
 25 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4172190

    ---

Associated Targets(Human)

LCK Tclin Tyrosine-protein kinase LCK (9212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CSF1R Tclin Macrophage colony stimulating factor receptor (5179 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 541.61Molecular Weight (Monoisotopic): 541.2325AlogP: 5.63#Rotatable Bonds: 10
Polar Surface Area: 99.56Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.70CX LogP: 5.55CX LogD: 5.55
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.27

References

1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ..  (2017)  Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders.,  141  [PMID:29107425] [10.1016/j.ejmech.2017.10.003]

Source