The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-5-((3,5-dimethoxybenzylidene)amino)-4-(3-methoxyphenoxy)-N-(4-morpholinophenyl)pyrimidin-2-amine ID: ALA4172190
PubChem CID: 137365221
Max Phase: Preclinical
Molecular Formula: C30H31N5O5
Molecular Weight: 541.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/c2cnc(Nc3ccc(N4CCOCC4)cc3)nc2Oc2cccc(OC)c2)cc(OC)c1
Standard InChI: InChI=1S/C30H31N5O5/c1-36-24-5-4-6-25(17-24)40-29-28(31-19-21-15-26(37-2)18-27(16-21)38-3)20-32-30(34-29)33-22-7-9-23(10-8-22)35-11-13-39-14-12-35/h4-10,15-20H,11-14H2,1-3H3,(H,32,33,34)/b31-19+
Standard InChI Key: SWBPCPSLZCXUEC-ZCTHSVRISA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
32.2281 -13.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2270 -14.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9350 -14.4562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6447 -14.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6418 -13.2241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9332 -12.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9308 -12.0017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6373 -11.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3441 -11.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0501 -11.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0481 -10.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3342 -10.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6311 -10.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3530 -14.4543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0601 -14.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7651 -14.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4717 -14.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4709 -13.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7575 -12.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0539 -13.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5203 -12.8193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8127 -13.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1072 -12.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1083 -12.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4014 -11.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6928 -12.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6956 -12.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4031 -13.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1719 -12.8159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8806 -13.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5850 -12.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5869 -11.9999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8781 -11.5912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1675 -12.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3289 -9.5483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0339 -9.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9894 -13.2350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2802 -12.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4016 -10.7763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6939 -10.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 23 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
18 29 1 0
12 35 1 0
35 36 1 0
27 37 1 0
37 38 1 0
25 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.61Molecular Weight (Monoisotopic): 541.2325AlogP: 5.63#Rotatable Bonds: 10Polar Surface Area: 99.56Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.70CX LogP: 5.55CX LogD: 5.55Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.27
References 1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ.. (2017) Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders., 141 [PMID:29107425 ] [10.1016/j.ejmech.2017.10.003 ]