The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Prop-2-yn-1-yl-2-Amino-6-(2-(2-hydroxyacetamido)pyridin-4-yl)-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-4H-chromene-3-carboxylate ID: ALA4172352
PubChem CID: 145951805
Max Phase: Preclinical
Molecular Formula: C25H21N3O7
Molecular Weight: 475.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(NC(=O)CO)c3)cc21
Standard InChI: InChI=1S/C25H21N3O7/c1-3-9-33-22(31)13-18-17-11-15(16-7-8-27-20(12-16)28-21(30)14-29)5-6-19(17)35-24(26)23(18)25(32)34-10-4-2/h1-2,5-8,11-12,18,29H,9-10,13-14,26H2,(H,27,28,30)
Standard InChI Key: FHWFDFKNPPZHOA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
18.6733 -5.5291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6722 -6.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3870 -6.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1035 -6.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1006 -5.5254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3852 -5.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8185 -6.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8150 -7.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5292 -8.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5252 -6.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2401 -6.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2412 -7.5871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9532 -7.9970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6687 -7.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6676 -6.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9510 -6.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3831 -7.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3819 -6.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0965 -6.7587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3816 -5.5214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8108 -6.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8106 -5.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8103 -4.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9488 -5.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2332 -5.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2310 -4.2842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5199 -5.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9442 -3.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6599 -4.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3755 -4.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9574 -6.7684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2433 -6.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5285 -6.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2439 -5.5303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8143 -6.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
14 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 3 0
16 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 3 0
2 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.46Molecular Weight (Monoisotopic): 475.1380AlogP: 1.07#Rotatable Bonds: 8Polar Surface Area: 150.07Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.59CX Basic pKa: 4.10CX LogP: 1.23CX LogD: 1.22Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.49
References 1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C.. (2018) Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells., 61 (15): [PMID:29995404 ] [10.1021/acs.jmedchem.8b00813 ]