The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Prop-2-yn-1-yl-2-Amino-6-(2-((2-hydroxyethyl)carbamoyl)-pyridin-4-yl)-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-4H-chromene-3-carboxylate ID: ALA4172637
PubChem CID: 145949479
Max Phase: Preclinical
Molecular Formula: C26H23N3O7
Molecular Weight: 489.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(C(=O)NCCO)c3)cc21
Standard InChI: InChI=1S/C26H23N3O7/c1-3-11-34-22(31)15-19-18-13-16(17-7-8-28-20(14-17)25(32)29-9-10-30)5-6-21(18)36-24(27)23(19)26(33)35-12-4-2/h1-2,5-8,13-14,19,30H,9-12,15,27H2,(H,29,32)
Standard InChI Key: WOEFSUBHBYXQKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
15.9609 -27.3705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9598 -28.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6745 -28.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3910 -28.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3881 -27.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6727 -26.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1061 -28.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1024 -29.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8168 -29.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8128 -28.1949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5276 -28.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5287 -29.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2408 -29.8384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9562 -29.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9551 -28.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2385 -28.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6707 -29.8392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6695 -28.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3840 -28.6001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6692 -27.3629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0984 -28.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0981 -27.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0979 -26.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2363 -27.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5208 -26.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5184 -26.1257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8074 -27.3651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2318 -25.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9473 -26.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6630 -26.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2449 -28.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5308 -28.1967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2443 -29.4348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5295 -29.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8154 -29.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1006 -29.8456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
14 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 3 0
16 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 3 0
2 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.48Molecular Weight (Monoisotopic): 489.1536AlogP: 0.86#Rotatable Bonds: 9Polar Surface Area: 150.07Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.23CX LogP: 0.98CX LogD: 0.98Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.52
References 1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C.. (2018) Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells., 61 (15): [PMID:29995404 ] [10.1021/acs.jmedchem.8b00813 ]