The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-(3-Fluoro-phenyl)-ethyl]-3-(1H-indol-2-yl)-5-trifluoromethyl-benzenesulfonamide ID: ALA4173450
PubChem CID: 145951212
Max Phase: Preclinical
Molecular Formula: C23H18F4N2O2S
Molecular Weight: 462.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2cc3ccccc3[nH]2)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C23H18F4N2O2S/c24-19-6-3-4-15(10-19)8-9-28-32(30,31)20-12-17(11-18(14-20)23(25,26)27)22-13-16-5-1-2-7-21(16)29-22/h1-7,10-14,28-29H,8-9H2
Standard InChI Key: QNSFLYYXXIZBAF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
36.2852 -26.2038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1109 -26.2079 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.6996 -25.4903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4042 -27.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4031 -28.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1189 -28.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8364 -28.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8336 -27.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1172 -27.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6871 -28.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9719 -28.2751 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.6865 -29.5162 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.9660 -29.0955 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.8290 -25.7947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5416 -26.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2560 -25.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9727 -26.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9732 -27.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6891 -27.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4044 -27.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3994 -26.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6829 -25.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6912 -28.2604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5450 -28.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6390 -29.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3004 -28.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8522 -28.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4417 -29.6690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8467 -30.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6661 -30.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0789 -29.6676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6674 -28.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
9 2 1 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
7 24 1 0
24 25 1 0
25 28 1 0
27 26 1 0
26 24 2 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.47Molecular Weight (Monoisotopic): 462.1025AlogP: 5.51#Rotatable Bonds: 6Polar Surface Area: 61.96Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.87CX Basic pKa: ┄CX LogP: 5.50CX LogD: 5.50Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.60
References 1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S.. (2018) Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening., 152 [PMID:29730188 ] [10.1016/j.ejmech.2018.04.018 ]