The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11alpha-(4-(2-(pyrrolidin-1-yl)acetamido)benzoyl)oxy-3,17beta-dihydroxyestra-1,3,5(10)-triene ID: ALA4173476
PubChem CID: 145952292
Max Phase: Preclinical
Molecular Formula: C31H38N2O5
Molecular Weight: 518.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12C[C@@H](OC(=O)c3ccc(NC(=O)CN4CCCC4)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O
Standard InChI: InChI=1S/C31H38N2O5/c1-31-17-26(29-23-11-9-22(34)16-20(23)6-10-24(29)25(31)12-13-27(31)35)38-30(37)19-4-7-21(8-5-19)32-28(36)18-33-14-2-3-15-33/h4-5,7-9,11,16,24-27,29,34-35H,2-3,6,10,12-15,17-18H2,1H3,(H,32,36)/t24-,25-,26+,27-,29+,31-/m0/s1
Standard InChI Key: HHHHMPDGIQPWPC-DFKRMGCYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
31.9447 -7.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9365 -8.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2266 -8.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5209 -8.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8151 -8.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8068 -9.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2390 -6.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5250 -7.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2307 -9.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7124 -8.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1011 -8.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7248 -7.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5209 -9.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1093 -9.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1994 -7.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3953 -9.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3953 -8.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9365 -6.4756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9766 -6.2651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6896 -9.7361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2184 -7.6932 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.5126 -8.9148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.9365 -8.9189 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.8191 -6.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8227 -6.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1168 -5.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5322 -5.6461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1225 -4.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4174 -4.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7069 -4.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7059 -5.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4115 -6.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0005 -4.4066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0030 -3.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2966 -3.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7120 -3.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7145 -2.3658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3800 -1.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1299 -1.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3127 -1.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0579 -1.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
5 4 1 0
6 5 2 0
7 1 1 0
8 7 1 0
9 3 1 0
10 2 1 0
11 5 1 0
12 1 1 0
13 9 1 0
14 6 1 0
15 12 1 0
16 17 1 0
17 11 2 0
1 18 1 1
12 19 1 1
20 16 1 0
3 21 1 1
4 22 1 6
2 23 1 6
10 15 1 0
3 4 1 0
6 13 1 0
14 16 2 0
8 24 1 6
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.65Molecular Weight (Monoisotopic): 518.2781AlogP: 4.48#Rotatable Bonds: 5Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.59CX Basic pKa: 7.27CX LogP: 4.47CX LogD: 4.22Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.51Np Likeness Score: 0.60
References 1. Lao K, Wang Y, Chen M, Zhang J, You Q, Xiang H.. (2017) Design, synthesis and biological evaluation of novel 2-methoxyestradiol analogs as dual selective estrogen receptor modulators (SERMs) and antiangiogenic agents., 139 [PMID:28810190 ] [10.1016/j.ejmech.2017.08.016 ]