The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Prop-2-yn-1-yl-2-Amino-6-(2-(dimethylamino)pyridin-4-yl)-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-4H-chromene-3-carboxylate ID: ALA4173491
PubChem CID: 145949515
Max Phase: Preclinical
Molecular Formula: C25H23N3O5
Molecular Weight: 445.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(N(C)C)c3)cc21
Standard InChI: InChI=1S/C25H23N3O5/c1-5-11-31-22(29)15-19-18-13-16(17-9-10-27-21(14-17)28(3)4)7-8-20(18)33-24(26)23(19)25(30)32-12-6-2/h1-2,7-10,13-14,19H,11-12,15,26H2,3-4H3
Standard InChI Key: MBPADZLRXSZUQW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
17.1317 -13.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1306 -14.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8453 -14.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5618 -14.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5590 -13.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8436 -12.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2770 -14.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2733 -15.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9876 -15.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9835 -14.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6984 -14.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6995 -15.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4115 -15.7761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1270 -15.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1260 -14.5383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4093 -14.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8415 -15.7769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8402 -14.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5549 -14.5377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8400 -13.3005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2693 -14.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2690 -13.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2686 -12.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4071 -13.2988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6915 -12.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6893 -12.0634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9782 -13.3028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4027 -11.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1182 -12.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8338 -12.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4158 -14.5474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7017 -14.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4151 -15.3724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
14 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 3 0
16 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 3 0
2 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.48Molecular Weight (Monoisotopic): 445.1638AlogP: 2.20#Rotatable Bonds: 7Polar Surface Area: 103.98Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.55CX LogP: 2.91CX LogD: 2.86Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -0.60
References 1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C.. (2018) Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells., 61 (15): [PMID:29995404 ] [10.1021/acs.jmedchem.8b00813 ]