The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dimethoxybenzyl)-3-(1-((2-(pyrimidin-2-ylamino)pyridin-4-yl)oxy)ethyl)benzamide ID: ALA4174101
PubChem CID: 141482504
Max Phase: Preclinical
Molecular Formula: C27H27N5O4
Molecular Weight: 485.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)c2cccc(C(C)Oc3ccnc(Nc4ncccn4)c3)c2)cc1OC
Standard InChI: InChI=1S/C27H27N5O4/c1-18(36-22-10-13-28-25(16-22)32-27-29-11-5-12-30-27)20-6-4-7-21(15-20)26(33)31-17-19-8-9-23(34-2)24(14-19)35-3/h4-16,18H,17H2,1-3H3,(H,31,33)(H,28,29,30,32)
Standard InChI Key: DCVDIUDYOUIQBI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
24.4648 -12.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4636 -13.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1758 -13.8702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8896 -13.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8868 -12.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1740 -12.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6021 -13.8682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6034 -14.6895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1716 -11.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8781 -10.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8757 -10.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5870 -11.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5873 -12.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2954 -12.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0028 -12.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9978 -11.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2891 -10.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7028 -10.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4131 -11.3827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6975 -10.1616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4185 -12.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1288 -12.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1313 -13.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8408 -13.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5468 -13.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5389 -12.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8288 -12.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8457 -14.6398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2577 -13.8124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1405 -15.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9622 -13.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8914 -15.0997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8923 -15.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6048 -16.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3178 -15.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3134 -15.0953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
24 28 1 0
25 29 1 0
28 30 1 0
29 31 1 0
8 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.54Molecular Weight (Monoisotopic): 485.2063AlogP: 4.70#Rotatable Bonds: 10Polar Surface Area: 107.49Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.58CX Basic pKa: 4.28CX LogP: 4.01CX LogD: 4.01Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.09
References 1. Tian Y, Zhang T, Long L, Li Z, Wan S, Wang G, Yu Y, Hou J, Wu X, Zhang J.. (2018) Design, synthesis, biological evaluation and molecular modeling of novel 2-amino-4-(1-phenylethoxy) pyridine derivatives as potential ROS1 inhibitors., 143 [PMID:29174814 ] [10.1016/j.ejmech.2017.11.002 ]