3'-(Pyrrolidine-1-sulfonyl)-5-trifluoromethyl-biphenyl-3-sulfonic acid [2-(3-fluoro-phenyl)-ethyl]-amide

ID: ALA4174135

PubChem CID: 145950181

Max Phase: Preclinical

Molecular Formula: C25H24F4N2O4S2

Molecular Weight: 556.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2cccc(S(=O)(=O)N3CCCC3)c2)cc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C25H24F4N2O4S2/c26-22-7-3-5-18(13-22)9-10-30-36(32,33)24-16-20(14-21(17-24)25(27,28)29)19-6-4-8-23(15-19)37(34,35)31-11-1-2-12-31/h3-8,13-17,30H,1-2,9-12H2

Standard InChI Key:  WXHFJVIEQIPEMU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   41.9747  -14.4583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.1497  -14.4583    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.5622  -15.1727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.1748   -9.9166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.9998   -9.9207    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.5908   -9.2043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2941  -11.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2930  -11.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0078  -12.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7243  -11.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7214  -11.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0061  -10.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5783  -12.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8641  -11.9886    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.5776  -13.2267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.8581  -12.8083    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.7168   -9.5101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4325   -9.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1457   -9.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8614   -9.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8619  -10.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5767  -11.1488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2910  -10.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2858   -9.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5705   -9.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5789  -11.9738    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.4358  -12.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4358  -13.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1500  -13.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8648  -13.2236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8609  -12.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1460  -11.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4369  -14.8756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6865  -14.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1351  -15.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5484  -15.8710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3551  -15.6985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  8 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
 12  5  1  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 22 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 10 27  1  0
 29  2  1  0
  2 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4174135

    ---

Associated Targets(Human)

ERBB4 Tclin Receptor protein-tyrosine kinase erbB-4 (2748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDPK1 Tchem 3-phosphoinositide dependent protein kinase-1 (3758 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.60Molecular Weight (Monoisotopic): 556.1114AlogP: 4.82#Rotatable Bonds: 8
Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.90CX Basic pKa: CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.80

References

1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S..  (2018)  Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening.,  152  [PMID:29730188] [10.1016/j.ejmech.2018.04.018]

Source