The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3'-(Pyrrolidine-1-sulfonyl)-5-trifluoromethyl-biphenyl-3-sulfonic acid [2-(3-fluoro-phenyl)-ethyl]-amide ID: ALA4174135
PubChem CID: 145950181
Max Phase: Preclinical
Molecular Formula: C25H24F4N2O4S2
Molecular Weight: 556.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2cccc(S(=O)(=O)N3CCCC3)c2)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C25H24F4N2O4S2/c26-22-7-3-5-18(13-22)9-10-30-36(32,33)24-16-20(14-21(17-24)25(27,28)29)19-6-4-8-23(15-19)37(34,35)31-11-1-2-12-31/h3-8,13-17,30H,1-2,9-12H2
Standard InChI Key: WXHFJVIEQIPEMU-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
41.9747 -14.4583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1497 -14.4583 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.5622 -15.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1748 -9.9166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9998 -9.9207 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.5908 -9.2043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2941 -11.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2930 -11.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0078 -12.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7243 -11.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7214 -11.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0061 -10.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5783 -12.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8641 -11.9886 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.5776 -13.2267 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.8581 -12.8083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.7168 -9.5101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4325 -9.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1457 -9.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8614 -9.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8619 -10.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5767 -11.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2910 -10.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2858 -9.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5705 -9.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5789 -11.9738 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.4358 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4358 -13.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1500 -13.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8648 -13.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8609 -12.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1460 -11.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4369 -14.8756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6865 -14.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1351 -15.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5484 -15.8710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3551 -15.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
8 13 1 0
13 14 1 0
13 15 1 0
13 16 1 0
12 5 1 0
5 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
10 27 1 0
29 2 1 0
2 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.60Molecular Weight (Monoisotopic): 556.1114AlogP: 4.82#Rotatable Bonds: 8Polar Surface Area: 83.55Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.90CX Basic pKa: ┄CX LogP: 4.94CX LogD: 4.94Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.80
References 1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S.. (2018) Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening., 152 [PMID:29730188 ] [10.1016/j.ejmech.2018.04.018 ]