(R)-6-amino-2-(4-(2-((R)-2-((S)-2-amino-3-(4-hydroxyphenyl)propanoyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamido)acetamido)butanamido)hexanoic acid

ID: ALA4174537

PubChem CID: 145949356

Max Phase: Preclinical

Molecular Formula: C31H42N6O7

Molecular Weight: 610.71

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCC[C@@H](NC(=O)CCCNC(=O)CNC(=O)[C@H]1Cc2ccccc2CN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O

Standard InChI:  InChI=1S/C31H42N6O7/c32-14-4-3-8-25(31(43)44)36-27(39)9-5-15-34-28(40)18-35-29(41)26-17-21-6-1-2-7-22(21)19-37(26)30(42)24(33)16-20-10-12-23(38)13-11-20/h1-2,6-7,10-13,24-26,38H,3-5,8-9,14-19,32-33H2,(H,34,40)(H,35,41)(H,36,39)(H,43,44)/t24-,25+,26+/m0/s1

Standard InChI Key:  GISRMDCBLIDDCJ-JIMJEQGWSA-N

Molfile:  

     RDKit          2D

 44 46  0  0  0  0  0  0  0  0999 V2000
    3.0543  -22.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0532  -23.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7705  -24.1823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4895  -23.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4867  -22.9370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7687  -22.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3358  -24.1814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1980  -22.5186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9166  -22.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6321  -22.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9197  -23.7590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3507  -22.9262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6290  -21.6859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3514  -23.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7827  -22.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0637  -22.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7838  -23.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0678  -24.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0646  -24.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7767  -25.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4935  -24.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4932  -24.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0603  -21.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7755  -21.2626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3415  -21.2684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4944  -21.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2055  -21.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9243  -21.6652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2021  -20.4293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6396  -21.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3531  -21.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0653  -21.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7789  -21.6588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4912  -21.2460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7802  -22.4820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2046  -21.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9169  -21.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2060  -22.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4938  -22.8924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9195  -22.8901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6304  -21.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3427  -21.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0562  -21.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7684  -21.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  1
 10 12  1  0
 10 13  2  0
 12 14  1  0
 12 16  1  0
 14 18  1  0
 17 15  1  0
 15 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 16 23  1  1
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 36 37  1  0
 36 38  1  6
 38 39  2  0
 38 40  1  0
 37 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4174537

    ---

Associated Targets(Human)

OPRD1 Tclin Opioid receptors; mu & delta (1530 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRD1 Tclin Delta opioid receptor (15096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 610.71Molecular Weight (Monoisotopic): 610.3115AlogP: -0.07#Rotatable Bonds: 16
Polar Surface Area: 217.18Molecular Species: ZWITTERIONHBA: 8HBD: 7
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3
CX Acidic pKa: 3.65CX Basic pKa: 10.28CX LogP: -2.91CX LogD: -3.24
Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: -0.22

References

1. Olson KM, Keresztes A, Tashiro JK, Daconta LV, Hruby VJ, Streicher JM..  (2018)  Synthesis and Evaluation of a Novel Bivalent Selective Antagonist for the Mu-Delta Opioid Receptor Heterodimer that Reduces Morphine Withdrawal in Mice.,  61  (14): [PMID:29939746] [10.1021/acs.jmedchem.8b00403]

Source