The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-6-amino-2-(4-(2-((R)-2-((S)-2-amino-3-(4-hydroxyphenyl)propanoyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamido)acetamido)butanamido)hexanoic acid ID: ALA4174537
PubChem CID: 145949356
Max Phase: Preclinical
Molecular Formula: C31H42N6O7
Molecular Weight: 610.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC[C@@H](NC(=O)CCCNC(=O)CNC(=O)[C@H]1Cc2ccccc2CN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O
Standard InChI: InChI=1S/C31H42N6O7/c32-14-4-3-8-25(31(43)44)36-27(39)9-5-15-34-28(40)18-35-29(41)26-17-21-6-1-2-7-22(21)19-37(26)30(42)24(33)16-20-10-12-23(38)13-11-20/h1-2,6-7,10-13,24-26,38H,3-5,8-9,14-19,32-33H2,(H,34,40)(H,35,41)(H,36,39)(H,43,44)/t24-,25+,26+/m0/s1
Standard InChI Key: GISRMDCBLIDDCJ-JIMJEQGWSA-N
Molfile:
RDKit 2D
44 46 0 0 0 0 0 0 0 0999 V2000
3.0543 -22.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0532 -23.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7705 -24.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4895 -23.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4867 -22.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7687 -22.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3358 -24.1814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1980 -22.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9166 -22.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6321 -22.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9197 -23.7590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3507 -22.9262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6290 -21.6859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3514 -23.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7827 -22.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0637 -22.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7838 -23.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0678 -24.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0646 -24.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7767 -25.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4935 -24.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4932 -24.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0603 -21.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7755 -21.2626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3415 -21.2684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4944 -21.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2055 -21.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9243 -21.6652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2021 -20.4293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6396 -21.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3531 -21.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0653 -21.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7789 -21.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4912 -21.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7802 -22.4820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2046 -21.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9169 -21.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2060 -22.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4938 -22.8924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9195 -22.8901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6304 -21.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3427 -21.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0562 -21.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7684 -21.2392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 1 1
10 12 1 0
10 13 2 0
12 14 1 0
12 16 1 0
14 18 1 0
17 15 1 0
15 16 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
16 23 1 1
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
36 38 1 6
38 39 2 0
38 40 1 0
37 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.71Molecular Weight (Monoisotopic): 610.3115AlogP: -0.07#Rotatable Bonds: 16Polar Surface Area: 217.18Molecular Species: ZWITTERIONHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.65CX Basic pKa: 10.28CX LogP: -2.91CX LogD: -3.24Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: -0.22
References 1. Olson KM, Keresztes A, Tashiro JK, Daconta LV, Hruby VJ, Streicher JM.. (2018) Synthesis and Evaluation of a Novel Bivalent Selective Antagonist for the Mu-Delta Opioid Receptor Heterodimer that Reduces Morphine Withdrawal in Mice., 61 (14): [PMID:29939746 ] [10.1021/acs.jmedchem.8b00403 ]