3-Methyl-2-(8-methyl-2-oxo-3-p-tolyl-2H-chromen-6-yl)-2,3-dihydroquinazolin-4(1h)-one

ID: ALA4174798

PubChem CID: 145949989

Max Phase: Preclinical

Molecular Formula: C26H22N2O3

Molecular Weight: 410.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2cc3cc(C4Nc5ccccc5C(=O)N4C)cc(C)c3oc2=O)cc1

Standard InChI:  InChI=1S/C26H22N2O3/c1-15-8-10-17(11-9-15)21-14-18-13-19(12-16(2)23(18)31-26(21)30)24-27-22-7-5-4-6-20(22)25(29)28(24)3/h4-14,24,27H,1-3H3

Standard InChI Key:  CAUFJROIYYUVQC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    5.2484   -7.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2473   -8.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9553   -8.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9535   -6.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6621   -7.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6610   -8.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3672   -8.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0791   -8.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0802   -7.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3695   -6.8404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7855   -8.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7818   -9.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4876   -9.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1974   -9.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1971   -8.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4907   -8.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7889   -6.8471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5428   -8.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8356   -8.0696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1296   -8.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5441   -9.2968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8320   -9.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1290   -9.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4224   -9.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4177  -10.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1254  -10.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8291  -10.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8382   -7.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4228   -8.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9511   -6.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9045   -9.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
  9 17  2  0
 18 19  1  0
 18 21  1  0
 19 20  1  0
 20 23  1  0
 22 21  1  0
  2 18  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 28  1  0
 20 29  2  0
  4 30  1  0
 14 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4174798

    ---

Associated Targets(Human)

HCAR2 Tclin Hydroxycarboxylic acid receptor 2 (1903 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.47Molecular Weight (Monoisotopic): 410.1630AlogP: 5.27#Rotatable Bonds: 2
Polar Surface Area: 62.55Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.47CX Basic pKa: CX LogP: 5.78CX LogD: 5.78
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -0.46

References

1. Singh LR, Kumar A, Upadhyay A, Gupta S, Palanati GR, Sikka K, Siddiqi MI, Yadav PN, Sashidhara KV..  (2018)  Discovery of coumarin-dihydroquinazolinone analogs as niacin receptor 1 agonist with in-vivo anti-obesity efficacy.,  152  [PMID:29709786] [10.1016/j.ejmech.2018.04.037]

Source