The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Fluoro-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenanthridin-6(5H)-one ID: ALA4174942
PubChem CID: 145949365
Max Phase: Preclinical
Molecular Formula: C16H8F7NO2
Molecular Weight: 379.23
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=c1[nH]c2c(F)cc(C(O)(C(F)(F)F)C(F)(F)F)cc2c2ccccc12
Standard InChI: InChI=1S/C16H8F7NO2/c17-11-6-7(14(26,15(18,19)20)16(21,22)23)5-10-8-3-1-2-4-9(8)13(25)24-12(10)11/h1-6,26H,(H,24,25)
Standard InChI Key: CMSGVURZCKVOGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
41.7217 -28.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4272 -29.2938 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.5283 -28.4007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.2328 -29.1670 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.4267 -28.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1320 -28.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8446 -26.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8434 -27.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5515 -28.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5497 -26.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2583 -26.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2571 -27.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6764 -26.8336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9656 -26.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.6752 -27.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9638 -28.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9588 -28.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6644 -29.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3765 -28.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3780 -28.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3851 -26.4267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4280 -27.6536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7166 -28.0693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.4315 -29.2909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.7163 -28.8782 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.5472 -25.6092 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
5 6 1 0
1 6 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 14 1 0
12 16 1 0
15 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 21 2 0
8 6 1 0
6 22 1 0
5 23 1 0
5 24 1 0
5 25 1 0
10 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.23Molecular Weight (Monoisotopic): 379.0443AlogP: 4.13#Rotatable Bonds: 1Polar Surface Area: 53.09Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.29CX Basic pKa: ┄CX LogP: 4.01CX LogD: 3.65Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.49Np Likeness Score: -0.50
References 1. Nishiyama Y, Mori S, Makishima M, Fujii S, Kagechika H, Hashimoto Y, Ishikawa M.. (2018) Novel Nonsteroidal Progesterone Receptor (PR) Antagonists with a Phenanthridinone Skeleton., 9 (7): [PMID:30034593 ] [10.1021/acsmedchemlett.8b00058 ]