The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-methyl 2-((2R,3R)-3-((S)-1-((3R,4S,5S)-4-((R)-2-((S)-2-(dimethylamino)-3-methylbutanamido)-3-mercapto-N-methylpropanamido)-3-methoxy-5-methylheptanoyl)pyrrolidin-2-yl)-3-methoxy-2-methylpropanamido)-3-phenylpropanoate ID: ALA4175077
PubChem CID: 122531660
Max Phase: Preclinical
Molecular Formula: C39H65N5O8S
Molecular Weight: 764.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@@H]([C@@H](CC(=O)N1CCC[C@H]1[C@H](OC)[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC)OC)N(C)C(=O)[C@H](CS)NC(=O)[C@H](C(C)C)N(C)C
Standard InChI: InChI=1S/C39H65N5O8S/c1-12-25(4)34(43(8)38(48)29(23-53)41-37(47)33(24(2)3)42(6)7)31(50-9)22-32(45)44-20-16-19-30(44)35(51-10)26(5)36(46)40-28(39(49)52-11)21-27-17-14-13-15-18-27/h13-15,17-18,24-26,28-31,33-35,53H,12,16,19-23H2,1-11H3,(H,40,46)(H,41,47)/t25-,26+,28-,29-,30-,31+,33-,34-,35+/m0/s1
Standard InChI Key: VVVQBLDFTQSKLU-ZMRJGPQJSA-N
Molfile:
RDKit 2D
54 55 0 0 0 0 0 0 0 0999 V2000
18.2135 -10.8752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9212 -10.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6289 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3366 -10.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6289 -11.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5058 -10.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2135 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9212 -9.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6289 -9.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2135 -9.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0443 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7520 -10.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4597 -10.8752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7520 -9.6495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4597 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1674 -10.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8751 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1674 -9.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8751 -9.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4597 -9.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8751 -11.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5828 -10.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2905 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5828 -12.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2905 -11.6924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9983 -10.4666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7439 -10.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2907 -10.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8821 -9.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0828 -9.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9138 -11.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3065 -12.1448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4764 -12.9441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6910 -11.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8609 -12.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2983 -11.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2536 -13.1966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6381 -12.9024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8080 -13.7017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5852 -13.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1925 -13.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9672 -13.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5742 -13.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4045 -12.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6225 -12.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0189 -12.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5828 -9.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0304 -11.2013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.0443 -11.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3366 -12.1010 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.2007 -14.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4235 -13.9960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3706 -15.0478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8162 -14.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
1 6 1 0
1 7 1 0
2 8 1 1
8 9 1 0
8 10 1 0
11 4 1 6
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
16 13 1 1
16 17 1 0
16 18 1 0
18 19 1 0
18 20 1 1
17 21 1 1
17 22 1 0
22 23 1 0
21 24 1 0
23 25 2 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
27 31 1 0
31 32 1 1
32 33 1 0
31 34 1 0
34 35 1 0
34 36 1 1
35 37 2 0
35 38 1 0
39 38 1 1
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
19 47 1 0
27 48 1 6
11 49 1 0
49 50 1 0
39 51 1 0
51 52 1 0
51 53 2 0
52 54 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 764.04Molecular Weight (Monoisotopic): 763.4554AlogP: 2.81#Rotatable Bonds: 21Polar Surface Area: 146.82Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.96CX Basic pKa: 8.03CX LogP: 3.31CX LogD: 2.67Aromatic Rings: 1Heavy Atoms: 53QED Weighted: 0.13Np Likeness Score: 0.59
References 1. Dugal-Tessier J, Barnscher SD, Kanai A, Mendelsohn BA.. (2017) Synthesis and Evaluation of Dolastatin 10 Analogues Containing Heteroatoms on the Amino Acid Side Chains., 80 (9): [PMID:28885014 ] [10.1021/acs.jnatprod.7b00359 ]
