The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tert-butyl 4-((3-((4-methoxy-N-(pyridin-4-ylmethyl)benzamido)methyl)phenoxy)methyl)piperidine-1-carboxylate ID: ALA4175080
PubChem CID: 135187499
Max Phase: Preclinical
Molecular Formula: C32H39N3O5
Molecular Weight: 545.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)N(Cc2ccncc2)Cc2cccc(OCC3CCN(C(=O)OC(C)(C)C)CC3)c2)cc1
Standard InChI: InChI=1S/C32H39N3O5/c1-32(2,3)40-31(37)34-18-14-25(15-19-34)23-39-29-7-5-6-26(20-29)22-35(21-24-12-16-33-17-13-24)30(36)27-8-10-28(38-4)11-9-27/h5-13,16-17,20,25H,14-15,18-19,21-23H2,1-4H3
Standard InChI Key: CJERIKXMMZAWJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
12.1739 -12.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1728 -13.0278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8849 -13.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5987 -13.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5959 -12.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8831 -11.7953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3062 -11.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0196 -12.1952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7257 -11.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0226 -13.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4391 -12.1899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7226 -10.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4356 -10.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4329 -9.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7190 -9.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0105 -9.7396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0167 -10.5588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7319 -13.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7374 -14.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4459 -14.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1571 -14.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1514 -13.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4383 -13.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8602 -12.9994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5750 -13.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7148 -8.5027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4245 -8.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2839 -12.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9971 -13.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7038 -12.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7021 -12.1638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9874 -11.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2745 -12.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4084 -11.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1216 -12.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4055 -10.9272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1245 -12.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8378 -13.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4141 -13.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1178 -13.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
9 11 2 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
15 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
37 39 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.68Molecular Weight (Monoisotopic): 545.2890AlogP: 5.96#Rotatable Bonds: 9Polar Surface Area: 81.20Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.02CX LogP: 4.57CX LogD: 4.57Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.33
References 1. Wei C, Bajpai R, Sharma H, Heitmeier M, Jain AD, Matulis SM, Nooka AK, Mishra RK, Hruz PW, Schiltz GE, Shanmugam M.. (2017) Development of GLUT4-selective antagonists for multiple myeloma therapy., 139 [PMID:28837922 ] [10.1016/j.ejmech.2017.08.029 ]