The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3,5-dimethoxyphenyl)-3-(4-(4-fluorophenoxy)-2-(4-morpholinophenylamino)pyrimidin-5-yl)urea ID: ALA4175265
PubChem CID: 145950233
Max Phase: Preclinical
Molecular Formula: C29H29FN6O5
Molecular Weight: 560.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)Nc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2Oc2ccc(F)cc2)cc(OC)c1
Standard InChI: InChI=1S/C29H29FN6O5/c1-38-24-15-21(16-25(17-24)39-2)33-29(37)34-26-18-31-28(35-27(26)41-23-9-3-19(30)4-10-23)32-20-5-7-22(8-6-20)36-11-13-40-14-12-36/h3-10,15-18H,11-14H2,1-2H3,(H,31,32,35)(H2,33,34,37)
Standard InChI Key: ICVZCXNOCJMMOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
19.5080 -4.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5068 -5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2149 -5.5786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9246 -5.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9217 -4.3465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2131 -3.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2107 -3.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9171 -2.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6240 -3.1222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3300 -2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3280 -1.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6141 -1.4878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9110 -1.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6329 -5.5766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3400 -5.1669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0450 -5.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7516 -5.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7507 -4.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0374 -3.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3337 -4.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0339 -1.4824 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.4557 -3.9405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1644 -4.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8688 -3.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8707 -3.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1619 -2.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4513 -3.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8002 -3.9416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0926 -4.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3848 -3.9420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0928 -5.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6772 -4.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9699 -3.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2627 -4.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2625 -5.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9753 -5.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6795 -5.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5551 -3.9399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8473 -4.3483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9784 -6.3922 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2722 -6.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
11 21 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
18 22 1 0
1 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
34 38 1 0
38 39 1 0
36 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.59Molecular Weight (Monoisotopic): 560.2183AlogP: 5.65#Rotatable Bonds: 9Polar Surface Area: 119.10Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.39CX Basic pKa: 3.02CX LogP: 5.13CX LogD: 5.13Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.62
References 1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ.. (2017) Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders., 141 [PMID:29107425 ] [10.1016/j.ejmech.2017.10.003 ]