1-(3,5-dimethoxyphenyl)-3-(4-(4-fluorophenoxy)-2-(4-morpholinophenylamino)pyrimidin-5-yl)urea

ID: ALA4175265

PubChem CID: 145950233

Max Phase: Preclinical

Molecular Formula: C29H29FN6O5

Molecular Weight: 560.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)Nc2cnc(Nc3ccc(N4CCOCC4)cc3)nc2Oc2ccc(F)cc2)cc(OC)c1

Standard InChI:  InChI=1S/C29H29FN6O5/c1-38-24-15-21(16-25(17-24)39-2)33-29(37)34-26-18-31-28(35-27(26)41-23-9-3-19(30)4-10-23)32-20-5-7-22(8-6-20)36-11-13-40-14-12-36/h3-10,15-18H,11-14H2,1-2H3,(H,31,32,35)(H2,33,34,37)

Standard InChI Key:  ICVZCXNOCJMMOJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   19.5080   -4.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5068   -5.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2149   -5.5786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9246   -5.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9217   -4.3465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2131   -3.9412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2107   -3.1240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9171   -2.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6240   -3.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3300   -2.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3280   -1.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6141   -1.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9110   -1.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6329   -5.5766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3400   -5.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0450   -5.5748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7516   -5.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7507   -4.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0374   -3.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3337   -4.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0339   -1.4824    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.4557   -3.9405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1644   -4.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8688   -3.9421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8707   -3.1245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1619   -2.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4513   -3.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8002   -3.9416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0926   -4.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3848   -3.9420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0928   -5.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6772   -4.3507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9699   -3.9406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2627   -4.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2625   -5.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9753   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6795   -5.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5551   -3.9399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8473   -4.3483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9784   -6.3922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2722   -6.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  4 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 18 22  1  0
  1 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 34 38  1  0
 38 39  1  0
 36 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4175265

    ---

Associated Targets(Human)

LCK Tclin Tyrosine-protein kinase LCK (9212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.59Molecular Weight (Monoisotopic): 560.2183AlogP: 5.65#Rotatable Bonds: 9
Polar Surface Area: 119.10Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3
CX Acidic pKa: 10.39CX Basic pKa: 3.02CX LogP: 5.13CX LogD: 5.13
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.62

References

1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ..  (2017)  Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders.,  141  [PMID:29107425] [10.1016/j.ejmech.2017.10.003]

Source