The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methoxy-N-(3-((3-nitrobenzyl)oxy)benzyl)-N-(pyridin-4-ylmethyl)benzamide ID: ALA4175412
PubChem CID: 135187505
Max Phase: Preclinical
Molecular Formula: C28H25N3O5
Molecular Weight: 483.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)N(Cc2ccncc2)Cc2cccc(OCc3cccc([N+](=O)[O-])c3)c2)cc1
Standard InChI: InChI=1S/C28H25N3O5/c1-35-26-10-8-24(9-11-26)28(32)30(18-21-12-14-29-15-13-21)19-22-4-3-7-27(17-22)36-20-23-5-2-6-25(16-23)31(33)34/h2-17H,18-20H2,1H3
Standard InChI Key: CTIDVDPLXAFVRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
1.4514 -4.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4502 -5.7144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1583 -6.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8679 -5.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8651 -4.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1565 -4.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5713 -4.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2805 -4.8859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9867 -4.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2836 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6959 -4.8806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9836 -3.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6924 -3.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6897 -2.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9799 -2.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2714 -2.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2776 -3.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9928 -6.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9943 -6.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7027 -7.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4098 -6.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4041 -6.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6951 -5.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1088 -5.6859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8195 -6.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9758 -1.2098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6814 -0.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5242 -5.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2331 -6.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9373 -5.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9318 -4.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2162 -4.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5149 -4.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6527 -6.0738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3576 -5.6604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6583 -6.8910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
9 11 2 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
10 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
15 26 1 0
26 27 1 0
25 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
34 35 2 0
34 36 1 0
30 34 1 0
M CHG 2 34 1 36 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.1794AlogP: 5.42#Rotatable Bonds: 10Polar Surface Area: 94.80Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.02CX LogP: 4.85CX LogD: 4.85Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.22Np Likeness Score: -1.44
References 1. Wei C, Bajpai R, Sharma H, Heitmeier M, Jain AD, Matulis SM, Nooka AK, Mishra RK, Hruz PW, Schiltz GE, Shanmugam M.. (2017) Development of GLUT4-selective antagonists for multiple myeloma therapy., 139 [PMID:28837922 ] [10.1016/j.ejmech.2017.08.029 ]