The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-Methoxy-4-methylphenoxy)-N2-(4-morpholinophenyl)-N5-(4-(trifluoromethoxy)benzyl)pyrimidine-2,5-diamine ID: ALA4176246
PubChem CID: 145971460
Max Phase: Preclinical
Molecular Formula: C30H30F3N5O4
Molecular Weight: 581.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C)ccc1Oc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1NCc1ccc(OC(F)(F)F)cc1
Standard InChI: InChI=1S/C30H30F3N5O4/c1-20-3-12-26(27(17-20)39-2)41-28-25(34-18-21-4-10-24(11-5-21)42-30(31,32)33)19-35-29(37-28)36-22-6-8-23(9-7-22)38-13-15-40-16-14-38/h3-12,17,19,34H,13-16,18H2,1-2H3,(H,35,36,37)
Standard InChI Key: LBRBSHUBQCGPOB-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
7.0892 -21.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0880 -21.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7961 -22.3021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5057 -21.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5029 -21.0700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7943 -20.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7918 -19.8475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4983 -19.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2051 -19.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9111 -19.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9091 -18.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1952 -18.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4922 -18.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2141 -22.3001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9211 -21.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6262 -22.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3327 -21.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3319 -21.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6186 -20.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9149 -21.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3814 -20.6652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6737 -21.0739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9682 -20.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9694 -19.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2624 -19.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5538 -19.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5566 -20.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2642 -21.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6151 -18.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -18.2202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7756 -17.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0329 -20.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7416 -21.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4461 -20.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4479 -19.8458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7392 -19.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0286 -19.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8455 -19.4407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8442 -18.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8470 -17.8783 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5093 -18.0813 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1853 -18.0834 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 23 1 0
11 29 1 0
13 30 1 0
30 31 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
18 32 1 0
26 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.60Molecular Weight (Monoisotopic): 581.2250AlogP: 6.68#Rotatable Bonds: 10Polar Surface Area: 90.00Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.12CX LogP: 7.14CX LogD: 7.14Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.21Np Likeness Score: -1.42
References 1. Farag AK, Elkamhawy A, Londhe AM, Lee KT, Pae AN, Roh EJ.. (2017) Novel LCK/FMS inhibitors based on phenoxypyrimidine scaffold as potential treatment for inflammatory disorders., 141 [PMID:29107425 ] [10.1016/j.ejmech.2017.10.003 ]