The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(Aminomethyl)oxetan-3-yl]-2-(1,1-dioxido-2,3-dihydro-1,4-benzothiazepin-4(5H)-yl)-6-methylquinolin-4-amine ID: ALA4176594
PubChem CID: 145974331
Max Phase: Preclinical
Molecular Formula: C24H27FN4O
Molecular Weight: 406.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc(N3CCCc4ccc(F)cc4C3)cc(NC3(CN)COC3)c2c1
Standard InChI: InChI=1S/C24H27FN4O/c1-16-4-7-21-20(9-16)22(28-24(13-26)14-30-15-24)11-23(27-21)29-8-2-3-17-5-6-19(25)10-18(17)12-29/h4-7,9-11H,2-3,8,12-15,26H2,1H3,(H,27,28)
Standard InChI Key: LDHDNVRPASCZTE-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
16.6864 -9.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2642 -8.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6822 -7.9674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1044 -8.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9886 -11.9964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6983 -11.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6954 -10.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9868 -10.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2806 -11.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2828 -10.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5769 -10.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8682 -10.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8699 -11.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5764 -11.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4066 -11.9944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9833 -9.5419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3987 -9.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1047 -9.1242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0745 -11.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3436 -12.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9458 -13.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7541 -13.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8553 -11.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1619 -12.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9702 -12.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4728 -11.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1614 -11.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3539 -11.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1604 -10.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6610 -10.5911 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
9 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 10 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
6 15 1 0
8 16 1 0
16 1 1 0
1 17 1 0
17 18 1 0
15 19 1 0
19 23 1 0
15 20 1 0
20 21 1 0
24 22 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
12 29 1 0
27 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.51Molecular Weight (Monoisotopic): 406.2169AlogP: 3.77#Rotatable Bonds: 4Polar Surface Area: 63.41Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.71CX LogP: 4.14CX LogD: 0.51Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -1.31
References 1. Zheng X, Liang C, Wang L, Wang B, Liu Y, Feng S, Wu JZ, Gao L, Feng L, Chen L, Guo T, Shen HC, Yun H.. (2018) Discovery of Benzoazepinequinoline (BAQ) Derivatives as Novel, Potent, Orally Bioavailable Respiratory Syncytial Virus Fusion Inhibitors., 61 (22): [PMID:30339388 ] [10.1021/acs.jmedchem.8b01394 ]