The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 5,12-dioxo-8-(3-(piperidin-1-yl)propanamido)-5,12-dihydroindolizino[2,3-g]quinoline-6-carboxylate ID: ALA4176694
PubChem CID: 145975728
Max Phase: Preclinical
Molecular Formula: C26H26N4O5
Molecular Weight: 474.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1c2c(n3ccc(NC(=O)CCN4CCCCC4)cc13)C(=O)c1ncccc1C2=O
Standard InChI: InChI=1S/C26H26N4O5/c1-2-35-26(34)20-18-15-16(28-19(31)9-13-29-11-4-3-5-12-29)8-14-30(18)23-21(20)24(32)17-7-6-10-27-22(17)25(23)33/h6-8,10,14-15H,2-5,9,11-13H2,1H3,(H,28,31)
Standard InChI Key: AQCAQHYSCCJKTM-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
12.6650 -7.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6639 -8.4053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3719 -8.8143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3702 -7.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0788 -7.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0822 -8.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7945 -8.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7878 -7.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5047 -7.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5064 -8.3992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2868 -7.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7718 -7.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2845 -8.6522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6167 -9.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4372 -9.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9245 -8.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5914 -8.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7982 -9.6320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7833 -6.3472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6905 -6.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5077 -6.6009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2761 -5.9034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9221 -7.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7393 -7.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7376 -8.8240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1490 -9.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9662 -9.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7433 -10.2394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3777 -10.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1948 -10.2296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6023 -10.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4160 -10.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8255 -10.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4153 -9.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5955 -9.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 13 1 0
12 11 2 0
11 9 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
7 18 2 0
8 19 2 0
11 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
16 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.52Molecular Weight (Monoisotopic): 474.1903AlogP: 3.10#Rotatable Bonds: 6Polar Surface Area: 110.08Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.81CX Basic pKa: 9.18CX LogP: 2.22CX LogD: 0.44Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.98
References 1. Yu Q, Yang H, Zhu TW, Yu LM, Chen JW, Gu LQ, Huang ZS, An LK.. (2018) Synthesis, cytotoxicity and structure-activity relationship of indolizinoquinolinedione derivatives as DNA topoisomerase IB catalytic inhibitors., 152 [PMID:29705710 ] [10.1016/j.ejmech.2018.04.040 ]