Securamine J

ID: ALA4176797

PubChem CID: 145975975

Max Phase: Preclinical

Molecular Formula: C21H21Br2ClN4O4

Molecular Weight: 588.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@H]1[C@H](O)C2=NC(=O)N[C@@]23N2c4cc(Br)c(Br)cc4[C@H]4CC(=O)N1[C@]42C[C@H](Cl)C3(C)C

Standard InChI:  InChI=1S/C21H21Br2ClN4O4/c1-19(2)13(24)7-20-9-5-14(29)27(20)17(32-3)15(30)16-21(19,26-18(31)25-16)28(20)12-6-11(23)10(22)4-8(9)12/h4,6,9,13,15,17,30H,5,7H2,1-3H3,(H,26,31)/t9-,13+,15-,17+,20+,21-/m1/s1

Standard InChI Key:  XVYPXKFXSVSWCE-RFUHDIGYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   25.6257   -5.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9020   -5.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0976   -6.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2831   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0276   -5.1280    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.9020   -4.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6124   -4.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6146   -4.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2593   -5.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2563   -3.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9061   -4.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9100   -4.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6152   -3.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7716   -4.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7638   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0529   -3.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6193   -5.0626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0569   -4.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2570   -4.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2287   -5.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7027   -6.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9860   -5.8407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4924   -6.4265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8989   -7.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6443   -6.8952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2349   -3.1993    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.3639   -3.0236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9612   -3.7116    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   19.9630   -5.2136    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   22.6117   -7.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5069   -5.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6091   -4.0501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3801   -4.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  6
  4  6  1  0
  4  2  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 17  1  0
 13 11  1  0
 13 18  1  0
 18 14  1  1
 14 15  1  0
 15 16  1  0
 16 13  1  0
 17 18  1  0
 17 22  1  0
 19 20  1  0
 21 20  1  0
 19 14  1  0
 18  6  1  0
 22  2  1  0
 22 21  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 21  2  0
 13 26  1  6
 15 27  2  0
  7 28  1  0
  8 29  1  0
 24 30  2  0
 20 31  1  6
 19 32  1  1
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4176797

    ---

Associated Targets(Human)

A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HT-29 (80576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 588.68Molecular Weight (Monoisotopic): 585.9618AlogP: 3.29#Rotatable Bonds: 1
Polar Surface Area: 94.47Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.45CX Basic pKa: CX LogP: 4.36CX LogD: 4.36
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.49Np Likeness Score: 0.89

References

1. Hansen KØ, Isaksson J, Bayer A, Johansen JA, Andersen JH, Hansen E..  (2017)  Securamine Derivatives from the Arctic Bryozoan Securiflustra securifrons.,  80  (12): [PMID:29220180] [10.1021/acs.jnatprod.7b00703]

Source