The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((4-(4-cyano-2,6-dimethylphenoxy)thieno[3,2-d]pyrimidin-2-yl)amino)cyclohexyl)-4-fluorobenzamide ID: ALA4176863
PubChem CID: 134815772
Max Phase: Preclinical
Molecular Formula: C28H26FN5O2S
Molecular Weight: 515.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C#N)cc(C)c1Oc1nc(NC2CCC(NC(=O)c3ccc(F)cc3)CC2)nc2ccsc12
Standard InChI: InChI=1S/C28H26FN5O2S/c1-16-13-18(15-30)14-17(2)24(16)36-27-25-23(11-12-37-25)33-28(34-27)32-22-9-7-21(8-10-22)31-26(35)19-3-5-20(29)6-4-19/h3-6,11-14,21-22H,7-10H2,1-2H3,(H,31,35)(H,32,33,34)
Standard InChI Key: XVSRARCZAPWAQM-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.1285 -9.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5533 -10.6294 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5505 -9.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8377 -9.3933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8395 -11.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1276 -10.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5228 -11.1806 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.8568 -11.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6721 -11.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2608 -9.3873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2577 -8.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9692 -8.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9681 -7.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2565 -6.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5444 -7.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5439 -8.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2565 -6.1062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9684 -5.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9684 -4.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6802 -6.1062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6802 -4.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6806 -3.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9682 -3.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2540 -3.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2572 -4.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4206 -9.3938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4203 -8.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1300 -8.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1301 -7.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4216 -6.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7076 -7.3494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7111 -8.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0008 -8.5799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8412 -8.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4176 -6.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4162 -5.2896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9671 -2.4183 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 6 2 0
5 2 2 0
2 3 1 0
3 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
1 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
28 34 1 0
35 36 3 0
30 35 1 0
23 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.61Molecular Weight (Monoisotopic): 515.1791AlogP: 6.26#Rotatable Bonds: 6Polar Surface Area: 99.93Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.88CX LogP: 6.56CX LogD: 6.56Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.57
References 1. Kang D, Ding X, Wu G, Huo Z, Zhou Z, Zhao T, Feng D, Wang Z, Tian Y, Daelemans D, De Clercq E, Pannecouque C, Zhan P, Liu X.. (2017) Discovery of Thiophene[3,2-d]pyrimidine Derivatives as Potent HIV-1 NNRTIs Targeting the Tolerant Region I of NNIBP., 8 (11): [PMID:29152052 ] [10.1021/acsmedchemlett.7b00361 ]