N-(4-((4-(4-cyano-2,6-dimethylphenoxy)thieno[3,2-d]pyrimidin-2-yl)amino)cyclohexyl)-4-fluorobenzamide

ID: ALA4176863

PubChem CID: 134815772

Max Phase: Preclinical

Molecular Formula: C28H26FN5O2S

Molecular Weight: 515.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C#N)cc(C)c1Oc1nc(NC2CCC(NC(=O)c3ccc(F)cc3)CC2)nc2ccsc12

Standard InChI:  InChI=1S/C28H26FN5O2S/c1-16-13-18(15-30)14-17(2)24(16)36-27-25-23(11-12-37-25)33-28(34-27)32-22-9-7-21(8-10-22)31-26(35)19-3-5-20(29)6-4-19/h3-6,11-14,21-22H,7-10H2,1-2H3,(H,31,35)(H,32,33,34)

Standard InChI Key:  XVSRARCZAPWAQM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   12.1285   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5533  -10.6294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5505   -9.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8377   -9.3933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8395  -11.0389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1276  -10.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5228  -11.1806    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8568  -11.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6721  -11.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2608   -9.3873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2577   -8.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9692   -8.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9681   -7.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2565   -6.9275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5444   -7.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5439   -8.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2565   -6.1062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9684   -5.6976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9684   -4.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6802   -6.1062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6802   -4.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6806   -3.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9682   -3.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2540   -3.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2572   -4.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4206   -9.3938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4203   -8.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1300   -8.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1301   -7.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4216   -6.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7076   -7.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7111   -8.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0008   -8.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8412   -8.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4176   -6.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4162   -5.2896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9671   -2.4183    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
  1 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 32 33  1  0
 28 34  1  0
 35 36  3  0
 30 35  1  0
 23 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4176863

    ---

Associated Targets(Human)

MT4 (17854 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 2 (5592 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 515.61Molecular Weight (Monoisotopic): 515.1791AlogP: 6.26#Rotatable Bonds: 6
Polar Surface Area: 99.93Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.88CX LogP: 6.56CX LogD: 6.56
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.57

References

1. Kang D, Ding X, Wu G, Huo Z, Zhou Z, Zhao T, Feng D, Wang Z, Tian Y, Daelemans D, De Clercq E, Pannecouque C, Zhan P, Liu X..  (2017)  Discovery of Thiophene[3,2-d]pyrimidine Derivatives as Potent HIV-1 NNRTIs Targeting the Tolerant Region I of NNIBP.,  (11): [PMID:29152052] [10.1021/acsmedchemlett.7b00361]

Source