The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(3,5-Bis-cyclopropylmethoxy-phenyl)-2-butyl-6-methoxy-quinazolin-7-yloxy]-ethanol ID: ALA418785
PubChem CID: 44329642
Max Phase: Preclinical
Molecular Formula: C29H36N2O5
Molecular Weight: 492.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(-c2cc(OCC3CC3)cc(OCC3CC3)c2)c2cc(OC)c(OCCO)cc2n1
Standard InChI: InChI=1S/C29H36N2O5/c1-3-4-5-28-30-25-16-27(34-11-10-32)26(33-2)15-24(25)29(31-28)21-12-22(35-17-19-6-7-19)14-23(13-21)36-18-20-8-9-20/h12-16,19-20,32H,3-11,17-18H2,1-2H3
Standard InChI Key: BONRFJGOADUQPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
2.7292 -2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -2.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -3.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -2.5292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4417 -1.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -2.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -1.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -5.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6042 -6.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2333 -5.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1792 -6.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -7.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4292 -6.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1667 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4500 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -5.4167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -5.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3042 -5.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8875 -6.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5875 -2.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -1.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 0.7583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5917 -0.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1250 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8625 -0.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5667 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 0.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 2 2 0
6 3 1 0
7 1 2 0
8 3 2 0
9 6 2 0
10 7 1 0
11 10 2 0
12 25 1 0
13 26 1 0
14 4 2 0
15 4 1 0
16 12 1 0
17 12 1 0
18 13 1 0
19 13 1 0
20 15 2 0
21 14 1 0
22 20 1 0
23 21 1 0
24 20 1 0
25 23 1 0
26 24 1 0
27 10 1 0
28 11 1 0
29 9 1 0
30 31 1 0
31 32 1 0
32 28 1 0
33 27 1 0
34 29 1 0
35 34 1 0
36 35 1 0
8 11 1 0
5 9 1 0
21 22 2 0
19 18 1 0
17 16 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.62Molecular Weight (Monoisotopic): 492.2624AlogP: 5.60#Rotatable Bonds: 14Polar Surface Area: 82.93Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.33CX LogP: 5.51CX LogD: 5.51Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.46
References 1. Charpiot B, Brun J, Donze I, Naef R, Stefani M, Mueller T.. (1998) Quinazolines: combined type 3 and 4 phosphodiesterase inhibitors., 8 (20): [PMID:9873643 ] [10.1016/s0960-894x(98)00508-3 ]