1-(3,4-dimethylphenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine

ID: ALA4202451

PubChem CID: 145977229

Max Phase: Preclinical

Molecular Formula: C24H32N2O4

Molecular Weight: 412.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)Cc1ccc(OCC(O)CN2CCN(c3ccc(C)c(C)c3)CC2)cc1

Standard InChI:  InChI=1S/C24H32N2O4/c1-18-4-7-21(14-19(18)2)26-12-10-25(11-13-26)16-22(27)17-30-23-8-5-20(6-9-23)15-24(28)29-3/h4-9,14,22,27H,10-13,15-17H2,1-3H3

Standard InChI Key:  AQOVYXKHWOFMPX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    2.1241  -20.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1230  -20.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8310  -21.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5407  -20.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5378  -20.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8292  -19.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8268  -18.8776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5333  -18.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2422  -18.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9487  -18.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2446  -19.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6576  -18.8692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6545  -19.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3593  -20.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0682  -19.6825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0677  -18.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3584  -18.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7743  -20.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7723  -20.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4788  -21.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1879  -20.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1859  -20.0892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4788  -19.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8308  -22.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1230  -22.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1228  -23.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4154  -22.1490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7076  -22.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4778  -22.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8958  -21.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  3 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 20 29  1  0
 21 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4202451

    ---

Associated Targets(non-human)

Thoracic aorta (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.53Molecular Weight (Monoisotopic): 412.2362AlogP: 2.58#Rotatable Bonds: 8
Polar Surface Area: 62.24Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.60CX LogP: 3.75CX LogD: 3.34
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.18

References

1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M..  (2018)  Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes.,  28  (4): [PMID:29422390] [10.1016/j.bmcl.2018.01.068]

Source