(E)-N-(4-(N-(1-(3-(4-methylbenzylideneamino)-4-oxo-3,4-dihydroquinazolin-2-yl)ethyl)sulfamoyl)phenyl)acetamide

ID: ALA4202604

PubChem CID: 145975506

Max Phase: Preclinical

Molecular Formula: C26H25N5O4S

Molecular Weight: 503.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(S(=O)(=O)NC(C)c2nc3ccccc3c(=O)n2/N=C/c2ccc(C)cc2)cc1

Standard InChI:  InChI=1S/C26H25N5O4S/c1-17-8-10-20(11-9-17)16-27-31-25(29-24-7-5-4-6-23(24)26(31)33)18(2)30-36(34,35)22-14-12-21(13-15-22)28-19(3)32/h4-16,18,30H,1-3H3,(H,28,32)/b27-16+

Standard InChI Key:  ACBAUMZBXLYKEO-JVWAILMASA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   19.3961  -17.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9878  -18.0461    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.8126  -18.0415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6946  -15.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6935  -16.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4083  -16.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4065  -15.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1219  -15.5799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1227  -16.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8379  -16.8177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5530  -16.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5483  -15.5729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8324  -15.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8279  -14.3408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2602  -15.1561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9772  -15.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6892  -15.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4038  -15.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1153  -15.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1108  -14.3169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3887  -13.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6802  -14.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2691  -16.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2723  -17.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9820  -16.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9916  -18.8724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2777  -19.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2805  -20.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9972  -20.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7124  -20.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7060  -19.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0015  -21.3453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2892  -21.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2934  -22.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5725  -21.3527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8222  -13.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 13 14  2  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  1  0
 23 24  1  0
 23 25  1  0
 24  2  1  0
  2 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 20 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4202604

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.58Molecular Weight (Monoisotopic): 503.1627AlogP: 3.59#Rotatable Bonds: 7
Polar Surface Area: 122.52Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.19CX Basic pKa: 1.94CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.60

References

1. Patel TS, Bhatt JD, Vanparia SF, Patel UH, Dixit RB, Chudasama CJ, Patel BD, Dixit BC..  (2017)  Ionic liquid mediated stereoselective synthesis of alanine linked hybrid quinazoline-4(3H)-one derivatives perturbing the malarial reductase activity in folate pathway.,  25  (24): [PMID:29126742] [10.1016/j.bmc.2017.10.041]

Source