The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{2-Fluoro-4-[(4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-pentanedioic acid ID: ALA420280
PubChem CID: 136035435
Max Phase: Preclinical
Molecular Formula: C24H21FN4O6
Molecular Weight: 480.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc[nH]c(=O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)c(F)c1
Standard InChI: InChI=1S/C24H21FN4O6/c1-2-9-29(12-14-3-6-19-17(10-14)22(32)27-13-26-19)15-4-5-16(18(25)11-15)23(33)28-20(24(34)35)7-8-21(30)31/h1,3-6,10-11,13,20H,7-9,12H2,(H,28,33)(H,30,31)(H,34,35)(H,26,27,32)/t20-/m0/s1
Standard InChI Key: QZKRJYITWJUYDS-FQEVSTJZSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
-4.5792 -23.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5792 -24.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8671 -25.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8671 -23.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8671 -22.5750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1551 -23.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1567 -24.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4458 -25.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7327 -24.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7351 -23.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4467 -23.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0220 -23.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3062 -23.8093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4070 -23.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1241 -23.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8368 -23.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8346 -22.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1138 -22.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4041 -22.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5472 -22.1514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5435 -21.3264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2599 -22.5581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9723 -22.1420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6889 -22.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9682 -21.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6803 -20.9005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2514 -20.9077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4012 -22.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1178 -22.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1229 -23.3700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8311 -22.1289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3035 -24.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4122 -25.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1208 -25.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1082 -21.3321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16 17 2 0
3 7 1 0
17 18 1 0
8 9 2 0
18 19 2 0
19 14 1 0
6 4 1 0
17 20 1 0
9 10 1 0
20 21 2 0
20 22 1 0
10 11 2 0
22 23 1 0
11 6 1 0
23 24 1 6
4 5 2 0
23 25 1 0
10 12 1 0
1 2 1 0
25 26 1 0
25 27 2 0
12 13 1 0
24 28 1 0
1 4 1 0
28 29 1 0
13 14 1 0
6 7 2 0
29 30 1 0
29 31 2 0
14 15 2 0
13 32 1 0
2 3 2 0
32 33 1 0
15 16 1 0
33 34 3 0
7 8 1 0
18 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.45Molecular Weight (Monoisotopic): 480.1445AlogP: 1.75#Rotatable Bonds: 10Polar Surface Area: 152.69Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.14CX Basic pKa: 5.03CX LogP: 0.54CX LogD: -4.54Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.06
References 1. Jackman AL, Marsham PR, Thornton TJ, Bishop JA, O'Connor BM, Hughes LR, Calvert AH, Jones TR.. (1990) Quinazoline antifolate thymidylate synthase inhibitors: 2'-fluoro-N10-propargyl-5,8-dideazafolic acid and derivatives with modifications in the C2 position., 33 (11): [PMID:2231607 ] [10.1021/jm00173a025 ] 2. Srivastava V, Gupta SP, Siddiqi MI, Mishra BN.. (2010) 3D-QSAR studies on quinazoline antifolate thymidylate synthase inhibitors by CoMFA and CoMSIA models., 45 (4): [PMID:20153089 ] [10.1016/j.ejmech.2009.12.065 ]