The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-(hydroxymethyl)-5-(2-(5-(hydroxymethyl)-2-isopropoxyphenylamino)pyrimidin-4-yl)-3-methylindoline-7-carbonitrile ID: ALA4202865
PubChem CID: 130270954
Max Phase: Preclinical
Molecular Formula: C25H27N5O3
Molecular Weight: 445.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Oc1ccc(CO)cc1Nc1nccc(-c2cc(C#N)c3c(c2)[C@@](C)(CO)CN3)n1
Standard InChI: InChI=1S/C25H27N5O3/c1-15(2)33-22-5-4-16(12-31)8-21(22)30-24-27-7-6-20(29-24)17-9-18(11-26)23-19(10-17)25(3,14-32)13-28-23/h4-10,15,28,31-32H,12-14H2,1-3H3,(H,27,29,30)/t25-/m1/s1
Standard InChI Key: RISSKZZAQYAEKW-RUZDIDTESA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
12.5238 -20.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8114 -20.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5284 -21.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7685 -21.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7673 -22.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4820 -22.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1985 -22.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4838 -23.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7676 -24.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7670 -24.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4819 -25.2476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1988 -24.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1958 -24.0081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4802 -21.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1991 -21.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4713 -20.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6486 -20.3123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0540 -21.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3367 -20.7106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5192 -19.7315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9146 -25.2410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6276 -24.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3400 -25.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0526 -24.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0504 -23.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3295 -23.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6200 -24.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3414 -26.0621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3240 -22.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0564 -26.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0355 -22.3451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7702 -26.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0578 -27.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
14 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 8 1 0
14 15 2 0
15 2 1 0
2 16 1 0
16 17 1 0
17 14 1 0
4 18 1 0
18 19 3 0
1 20 1 0
12 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
26 29 1 0
28 30 1 0
29 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.52Molecular Weight (Monoisotopic): 445.2114AlogP: 3.71#Rotatable Bonds: 7Polar Surface Area: 123.32Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.50CX Basic pKa: 2.16CX LogP: 2.88CX LogD: 2.88Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -0.39
References 1. Kargbo RB.. (2017) New Substituted Cyanoindoline Derivatives as MAP3K14 Kinase Inhibitors for the Treatment of Cancer and Autoimmune Disorders., 8 (9): [PMID:28947934 ] [10.1021/acsmedchemlett.7b00330 ]