N-(1-(3,4-Difluorobenzyl)-1H-pyrazol-3-yl)-2-(1-methyl-1H-indazol-5-yl)acetamide

ID: ALA4203847

PubChem CID: 126740623

Max Phase: Preclinical

Molecular Formula: C20H17F2N5O

Molecular Weight: 381.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1ncc2cc(CC(=O)Nc3ccn(Cc4ccc(F)c(F)c4)n3)ccc21

Standard InChI:  InChI=1S/C20H17F2N5O/c1-26-18-5-3-13(8-15(18)11-23-26)10-20(28)24-19-6-7-27(25-19)12-14-2-4-16(21)17(22)9-14/h2-9,11H,10,12H2,1H3,(H,24,25,28)

Standard InChI Key:  GQWJSRCPJPOCIP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   47.0442  -16.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3396  -16.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6240  -16.4484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3655  -15.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5442  -15.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2899  -16.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9570  -16.9304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.5826  -16.8603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.8700  -16.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1589  -16.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4504  -16.4516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7411  -16.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7429  -15.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4522  -15.6370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8684  -15.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.7541  -16.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.4582  -16.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.4489  -15.6049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.7296  -15.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.0284  -15.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.1512  -15.1870    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   49.1705  -16.8255    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.0281  -16.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0269  -15.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2413  -15.3839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7569  -16.0527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2433  -16.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9876  -14.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  3  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 23  1  0
 24 13  1  0
 13 14  2  0
 14 11  1  0
  9 15  2  0
  1 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  1  1  0
 18 21  1  0
 17 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4203847

    ---

Associated Targets(Human)

CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1I Tclin Voltage-gated T-type calcium channel alpha-1I subunit (425 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.39Molecular Weight (Monoisotopic): 381.1401AlogP: 3.28#Rotatable Bonds: 5
Polar Surface Area: 64.74Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.30CX Basic pKa: 1.44CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -2.53

References

1. Bezençon O, Heidmann B, Siegrist R, Stamm S, Richard S, Pozzi D, Corminboeuf O, Roch C, Kessler M, Ertel EA, Reymond I, Pfeifer T, de Kanter R, Toeroek-Schafroth M, Moccia LG, Mawet J, Moon R, Rey M, Capeleto B, Fournier E..  (2017)  Discovery of a Potent, Selective T-type Calcium Channel Blocker as a Drug Candidate for the Treatment of Generalized Epilepsies.,  60  (23): [PMID:29116786] [10.1021/acs.jmedchem.7b01236]

Source