The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4beta-Methoxy-3beta-hydroxy-(-)-scirpusin A ID: ALA4203922
PubChem CID: 145976795
Max Phase: Preclinical
Molecular Formula: C29H24O8
Molecular Weight: 500.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/c2cc(O)cc3c2[C@@H](c2cc(O)cc(O)c2)[C@H](c2ccc(O)c(O)c2)O3)cc1O
Standard InChI: InChI=1S/C29H24O8/c1-36-25-7-3-15(8-24(25)35)2-4-16-9-21(32)14-26-27(16)28(18-10-19(30)13-20(31)11-18)29(37-26)17-5-6-22(33)23(34)12-17/h2-14,28-35H,1H3/b4-2+/t28-,29+/m1/s1
Standard InChI Key: GNUSRCGBWQRXLO-BLDUECSVSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
11.3927 -11.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1092 -10.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1063 -10.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3909 -9.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6777 -10.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6744 -10.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8894 -9.8108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4074 -10.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8947 -11.1447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6426 -11.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8349 -12.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5830 -12.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1378 -13.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9479 -13.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1959 -12.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5869 -10.4838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1721 -9.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3478 -9.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9373 -10.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3572 -11.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1801 -11.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8194 -9.6405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3925 -12.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1069 -12.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1067 -13.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3916 -13.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3911 -14.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1060 -15.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8231 -14.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8202 -13.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5389 -15.0020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1069 -15.8337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8220 -16.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5046 -13.9300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7766 -13.0619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1122 -10.4936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9326 -9.0592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 1
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
8 16 1 6
3 22 1 0
1 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
29 31 1 0
28 32 1 0
32 33 1 0
14 34 1 0
12 35 1 0
19 36 1 0
18 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.50Molecular Weight (Monoisotopic): 500.1471AlogP: 5.36#Rotatable Bonds: 5Polar Surface Area: 139.84Molecular Species: NEUTRALHBA: 8HBD: 6#RO5 Violations: 3HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.55CX Basic pKa: ┄CX LogP: 5.50CX LogD: 5.47Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 1.49
References 1. Park S, Kim YN, Kwak HJ, Jeong EJ, Kim SH.. (2018) Estrogenic activity of constituents from the rhizomes of Rheum undulatum Linné., 28 (4): [PMID:29402747 ] [10.1016/j.bmcl.2018.01.063 ]