2-chloro-4'-((2-methoxyethoxy)methoxy)-3'-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)biphenyl-4-carboxylic acid

ID: ALA4203950

PubChem CID: 145977797

Max Phase: Preclinical

Molecular Formula: C31H35ClO5

Molecular Weight: 523.07

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOCOc1ccc(-c2ccc(C(=O)O)cc2Cl)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C

Standard InChI:  InChI=1S/C31H35ClO5/c1-30(2)12-13-31(3,4)26-17-21(7-10-25(26)30)24-16-20(8-11-28(24)37-19-36-15-14-35-5)23-9-6-22(29(33)34)18-27(23)32/h6-11,16-18H,12-15,19H2,1-5H3,(H,33,34)

Standard InChI Key:  WGUBBZRLGNUQBI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   27.6731   -9.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2686   -8.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8596   -9.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8559   -6.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2686   -7.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6770   -6.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5670   -7.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5670   -8.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9775   -7.4538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9759   -8.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6802   -8.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3864   -8.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3841   -7.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6793   -7.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0875   -7.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7968   -7.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5028   -7.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5006   -6.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7866   -5.8124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0836   -6.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2075   -7.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2084   -8.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9163   -8.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6239   -8.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6191   -7.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9105   -7.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3735   -5.8206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3686   -5.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6585   -4.5990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6536   -3.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9435   -3.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9386   -2.5603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2285   -2.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3357   -8.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3390   -9.4795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0417   -8.2508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9060   -6.2142    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  1  0
  7  5  1  0
  8  2  1  0
  2 10  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 17 21  1  0
 20 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 34 35  1  0
 34 36  2  0
 24 34  1  0
 26 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4203950

    ---

Associated Targets(Human)

RARG Tclin Retinoic acid receptor gamma (1154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.07Molecular Weight (Monoisotopic): 522.2173AlogP: 7.72#Rotatable Bonds: 9
Polar Surface Area: 64.99Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.95CX Basic pKa: CX LogP: 8.01CX LogD: 4.82
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -0.06

References

1. Thoreau E, Arlabosse JM, Bouix-Peter C, Chambon S, Chantalat L, Daver S, Dumais L, Duvert G, Feret A, Ouvry G, Pascau J, Raffin C, Rodeville N, Soulet C, Tabet S, Talano S, Portal T..  (2018)  Structure-based design of Trifarotene (CD5789), a potent and selective RARγ agonist for the treatment of acne.,  28  (10): [PMID:29706423] [10.1016/j.bmcl.2018.04.036]

Source