The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Versixanthone G ID: ALA4204125
PubChem CID: 145977304
Max Phase: Preclinical
Molecular Formula: C32H30O14
Molecular Weight: 638.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@]12Oc3cc(C)c(-c4ccc5c(c4O)C(=O)C4=C(O)C[C@H](C)[C@@H](O)[C@]4(C(=O)OC)O5)c(O)c3C(=O)C1=C(O)CC[C@H]2O
Standard InChI: InChI=1S/C32H30O14/c1-11-10-17-21(27(39)22-14(33)6-8-18(35)31(22,46-17)29(41)43-3)25(37)19(11)13-5-7-16-20(24(13)36)26(38)23-15(34)9-12(2)28(40)32(23,45-16)30(42)44-4/h5,7,10,12,18,28,33-37,40H,6,8-9H2,1-4H3/t12-,18+,28+,31-,32+/m0/s1
Standard InChI Key: OZRXTHHVZWYBLI-RYGOELPRSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
1.8928 -3.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8928 -4.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6052 -5.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6052 -3.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6052 -5.8827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3177 -3.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3141 -4.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0234 -5.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0304 -3.4111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6620 -2.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4807 -2.7487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1607 -2.1992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6344 -2.5808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7978 -1.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0187 -5.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7441 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7377 -4.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4452 -5.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1593 -4.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1618 -3.8345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4537 -3.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4398 -5.8909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8777 -3.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8723 -5.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8641 -5.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5762 -6.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5826 -4.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5828 -3.8395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2953 -5.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2923 -5.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0021 -6.3164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0081 -4.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0099 -3.8391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7225 -5.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7182 -5.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4268 -6.3217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1442 -5.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1484 -5.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4353 -4.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4385 -3.8457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8563 -6.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3656 -6.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5567 -6.7900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8253 -7.4473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3922 -7.0888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2076 -7.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 7 2 0
6 4 1 0
3 5 1 0
6 7 1 0
6 9 1 0
7 8 1 0
8 17 1 0
16 9 1 0
6 10 1 1
10 11 1 0
10 12 2 0
4 13 1 1
11 14 1 0
8 15 2 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
20 23 1 0
24 19 1 0
24 25 2 0
25 26 1 0
26 30 2 0
29 27 2 0
27 24 1 0
27 28 1 0
29 30 1 0
29 32 1 0
30 31 1 0
31 35 1 0
34 32 1 0
32 33 2 0
34 35 1 0
34 39 2 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
37 41 1 6
35 42 1 1
42 43 1 0
42 44 2 0
36 45 1 1
43 46 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 638.58Molecular Weight (Monoisotopic): 638.1636AlogP: 2.23#Rotatable Bonds: 3Polar Surface Area: 226.58Molecular Species: NEUTRALHBA: 14HBD: 6#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.29CX Basic pKa: ┄CX LogP: 2.40CX LogD: 2.04Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.27Np Likeness Score: 1.77
References 1. Wu G, Qi X, Mo X, Yu G, Wang Q, Zhu T, Gu Q, Liu M, Li J, Li D.. (2018) Structure-based discovery of cytotoxic dimeric tetrahydroxanthones as potential topoisomerase I inhibitors from a marine-derived fungus., 148 [PMID:29466776 ] [10.1016/j.ejmech.2018.02.041 ] 2. Wu G, Qi X, Mo X, Yu G, Wang Q, Zhu T, Gu Q, Liu M, Li J, Li D.. (2018) Structure-based discovery of cytotoxic dimeric tetrahydroxanthones as potential topoisomerase I inhibitors from a marine-derived fungus., 148 [PMID:29466776 ] [10.1016/j.ejmech.2018.02.041 ]