The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R/S)-2-(4-(2-(2-Cyano-4-methyl-5-((4-((6-(2,2,2-trifluoroethyl)thieno-[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)methyl)-1H-indol-1-yl)-ethyl)piperazin-1-yl)propanamide ID: ALA4204241
PubChem CID: 130375989
Max Phase: Preclinical
Molecular Formula: C33H40F3N9OS
Molecular Weight: 667.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCN1CCN(C(C)C(N)=O)CC1
Standard InChI: InChI=1S/C33H40F3N9OS/c1-21-23(3-4-29-27(21)15-25(18-37)45(29)14-11-42-9-12-44(13-10-42)22(2)30(38)46)19-43-7-5-24(6-8-43)41-31-28-16-26(17-33(34,35)36)47-32(28)40-20-39-31/h3-4,15-16,20,22,24H,5-14,17,19H2,1-2H3,(H2,38,46)(H,39,40,41)
Standard InChI Key: RLGHLNGUWWFIOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 52 0 0 0 0 0 0 0 0999 V2000
30.7010 -26.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6999 -27.0934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4079 -27.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4061 -25.8650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1106 -26.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1113 -27.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8996 -27.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3770 -26.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8918 -26.0128 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.1941 -26.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5985 -25.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4157 -25.9525 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.1858 -25.2520 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.9989 -25.2463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.4090 -28.3196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1131 -28.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1128 -29.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8169 -29.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5265 -29.5450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5274 -28.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8187 -28.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2332 -29.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9419 -29.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6462 -29.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6453 -28.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9400 -28.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6423 -30.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3570 -28.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3549 -29.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1304 -29.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6117 -29.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1337 -28.4873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4286 -29.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2458 -29.1481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1285 -27.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8337 -27.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8286 -26.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5333 -26.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5302 -25.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8217 -24.8099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1148 -25.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1163 -26.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8197 -23.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5264 -23.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1110 -23.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2351 -23.9892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5244 -22.7652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
3 15 1 0
15 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
23 24 2 0
24 29 1 0
28 25 1 0
25 26 2 0
26 23 1 0
24 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
33 34 3 0
31 33 1 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
40 43 1 0
43 44 1 0
43 45 1 0
44 46 1 0
44 47 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.81Molecular Weight (Monoisotopic): 667.3029AlogP: 4.50#Rotatable Bonds: 10Polar Surface Area: 119.34Molecular Species: BASEHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.75CX LogP: 4.11CX LogD: 2.51Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.25Np Likeness Score: -1.70
References 1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J.. (2018) Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction., 61 (11): [PMID:29738674 ] [10.1021/acs.jmedchem.8b00071 ]