The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl)phenyl)-5-(piperazin-1-yl)-1,3,4-oxadiazole ID: ALA4204864
PubChem CID: 145977076
Max Phase: Preclinical
Molecular Formula: C23H27N7O
Molecular Weight: 417.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(C)cc(C)nc2c1Cc1ccc(-c2nnc(N3CCNCC3)o2)cc1
Standard InChI: InChI=1S/C23H27N7O/c1-4-20-19(21-25-15(2)13-16(3)30(21)28-20)14-17-5-7-18(8-6-17)22-26-27-23(31-22)29-11-9-24-10-12-29/h5-8,13,24H,4,9-12,14H2,1-3H3
Standard InChI Key: UHVOBMKJCCINOK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
7.4159 -11.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8570 -11.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6754 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0508 -11.1597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7934 -10.5135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6048 -10.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8149 -9.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1331 -9.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5019 -9.7550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0900 -8.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7752 -7.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5996 -11.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1174 -12.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2341 -9.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2330 -10.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9410 -10.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6507 -10.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6478 -9.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9392 -9.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5263 -9.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4142 -10.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6268 -11.5794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4430 -11.6212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7349 -10.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0991 -10.3445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5229 -10.6446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1008 -11.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8869 -11.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1015 -10.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5236 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7311 -9.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
1 12 1 0
3 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
14 20 1 0
20 7 1 0
17 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
24 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.52Molecular Weight (Monoisotopic): 417.2277AlogP: 2.96#Rotatable Bonds: 5Polar Surface Area: 84.38Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 3.17CX LogD: 1.96Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -1.49
References 1. Velcicky J, Miltz W, Oberhauser B, Orain D, Vaupel A, Weigand K, Dawson King J, Littlewood-Evans A, Nash M, Feifel R, Loetscher P.. (2017) Development of Selective, Orally Active GPR4 Antagonists with Modulatory Effects on Nociception, Inflammation, and Angiogenesis., 60 (9): [PMID:28445047 ] [10.1021/acs.jmedchem.6b01703 ]