The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-bromophenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine ID: ALA4205279
PubChem CID: 145978303
Max Phase: Preclinical
Molecular Formula: C22H27BrN2O4
Molecular Weight: 463.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1ccc(OCC(O)CN2CCN(c3ccc(Br)cc3)CC2)cc1
Standard InChI: InChI=1S/C22H27BrN2O4/c1-28-22(27)14-17-2-8-21(9-3-17)29-16-20(26)15-24-10-12-25(13-11-24)19-6-4-18(23)5-7-19/h2-9,20,26H,10-16H2,1H3
Standard InChI Key: UVNUFDMBXRXOSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
2.0581 -27.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0569 -28.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7650 -28.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4746 -28.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4718 -27.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7632 -26.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7607 -26.0755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4672 -25.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1762 -26.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8826 -25.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1786 -26.8885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5916 -26.0671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5884 -26.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2933 -27.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0022 -26.8804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0017 -26.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2923 -25.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7082 -27.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7063 -28.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4128 -28.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1218 -28.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1198 -27.2871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4127 -26.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7648 -29.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0570 -29.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0568 -30.5729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3494 -29.3469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6415 -29.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8297 -28.5167 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
3 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
21 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.37Molecular Weight (Monoisotopic): 462.1154AlogP: 2.73#Rotatable Bonds: 8Polar Surface Area: 62.24Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.48CX LogP: 3.49CX LogD: 3.15Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.12
References 1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M.. (2018) Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes., 28 (4): [PMID:29422390 ] [10.1016/j.bmcl.2018.01.068 ]