The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-ethyl-3-(4-(3-(4-isopropylpiperazin-1-yl)prop-1-enyl)benzyl)-6,8-dimethylimidazo[1,2-b]pyridazine ID: ALA4205308
PubChem CID: 145975612
Max Phase: Preclinical
Molecular Formula: C27H37N5
Molecular Weight: 431.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc2c(C)cc(C)nn2c1Cc1ccc(/C=C/CN2CCN(C(C)C)CC2)cc1
Standard InChI: InChI=1S/C27H37N5/c1-6-25-26(32-27(28-25)21(4)18-22(5)29-32)19-24-11-9-23(10-12-24)8-7-13-30-14-16-31(17-15-30)20(2)3/h7-12,18,20H,6,13-17,19H2,1-5H3/b8-7+
Standard InChI Key: WKMOBAVFRIULDB-BQYQJAHWSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
7.4159 -11.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8570 -11.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6754 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0508 -11.1597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7934 -10.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6048 -10.4706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8149 -9.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1331 -9.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5019 -9.7550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0900 -8.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7752 -7.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5996 -11.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1174 -12.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2341 -9.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2330 -10.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9410 -10.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6507 -10.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6478 -9.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9392 -9.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5263 -9.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3590 -10.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0661 -10.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7744 -10.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4815 -10.4971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1865 -10.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8915 -10.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8944 -9.6851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1862 -9.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4751 -9.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6030 -9.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3098 -9.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6048 -8.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
8 10 1 0
10 11 1 0
1 12 1 0
3 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
14 20 1 0
20 7 1 0
17 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.63Molecular Weight (Monoisotopic): 431.3049AlogP: 4.54#Rotatable Bonds: 7Polar Surface Area: 36.67Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.51CX LogP: 5.16CX LogD: 4.02Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.18
References 1. Velcicky J, Miltz W, Oberhauser B, Orain D, Vaupel A, Weigand K, Dawson King J, Littlewood-Evans A, Nash M, Feifel R, Loetscher P.. (2017) Development of Selective, Orally Active GPR4 Antagonists with Modulatory Effects on Nociception, Inflammation, and Angiogenesis., 60 (9): [PMID:28445047 ] [10.1021/acs.jmedchem.6b01703 ]