The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{5-[4-({[8-(5,6,7,8-tetrahydroquinolin-4-ylamino)octyl]amino}methyl)phenyl]-2-thienyl}benzonitrile ID: ALA4205583
PubChem CID: 145978548
Max Phase: Preclinical
Molecular Formula: C35H40N4S
Molecular Weight: 548.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(-c2ccc(-c3ccc(CNCCCCCCCCNc4ccnc5c4CCCC5)cc3)s2)cc1
Standard InChI: InChI=1S/C35H40N4S/c36-25-27-11-15-29(16-12-27)34-19-20-35(40-34)30-17-13-28(14-18-30)26-37-22-7-3-1-2-4-8-23-38-33-21-24-39-32-10-6-5-9-31(32)33/h11-21,24,37H,1-10,22-23,26H2,(H,38,39)
Standard InChI Key: LQWHFJQJPQKNBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
19.6371 -4.4271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3467 -4.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3439 -3.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6353 -2.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9290 -4.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9286 -3.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2226 -2.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5124 -3.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5128 -4.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2234 -4.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6333 -1.9725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3400 -1.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0487 -1.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7554 -1.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4641 -1.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1708 -1.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8795 -1.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5862 -1.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2949 -1.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0016 -1.5481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7103 -1.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7124 -2.7721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0053 -3.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0069 -3.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7162 -4.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4252 -3.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4201 -3.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7193 -5.2197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0653 -5.7027 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.3208 -6.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1380 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3875 -5.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8430 -7.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0311 -7.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5535 -7.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8887 -8.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7062 -8.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1802 -7.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4149 -9.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9379 -9.7878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 2 0
30 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 3 0
36 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.80Molecular Weight (Monoisotopic): 548.2974AlogP: 8.77#Rotatable Bonds: 14Polar Surface Area: 60.74Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.73CX LogP: 8.19CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.15Np Likeness Score: -0.83
References 1. Konstantinović J, Videnović M, Orsini S, Bogojević K, D'Alessandro S, Scaccabarozzi D, Terzić Jovanović N, Gradoni L, Basilico N, Šolaja BA.. (2018) Novel Aminoquinoline Derivatives Significantly Reduce Parasite Load in Leishmania infantum Infected Mice., 9 (7): [PMID:30034591 ] [10.1021/acsmedchemlett.8b00053 ]