The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Shornephine A ID: ALA4205964
PubChem CID: 10194855
Max Phase: Preclinical
Molecular Formula: C25H26N2O5
Molecular Weight: 434.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(C)(C)[C@]12Nc3c(O)cccc3[C@@]1(O)C[C@H]1C(=O)O[C@@H](Cc3ccccc3)C(=O)N12
Standard InChI: InChI=1S/C25H26N2O5/c1-4-23(2,3)25-24(31,16-11-8-12-18(28)20(16)26-25)14-17-22(30)32-19(21(29)27(17)25)13-15-9-6-5-7-10-15/h4-12,17,19,26,28,31H,1,13-14H2,2-3H3/t17-,19-,24-,25+/m0/s1
Standard InChI Key: VMKCIRAJEVFSFR-LQTXRJQHSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
22.4821 -10.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7747 -11.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3602 -11.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8607 -9.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8596 -10.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5744 -11.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5727 -9.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2880 -9.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2929 -10.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0803 -11.0151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0725 -9.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5640 -10.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5524 -9.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3404 -9.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3453 -10.0789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0584 -10.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7713 -10.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7666 -9.2454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0488 -8.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3329 -8.4249 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.0429 -8.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2094 -11.2512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4877 -10.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2002 -10.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5755 -12.0067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6539 -8.9582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1896 -11.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4009 -12.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9142 -10.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6263 -10.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6231 -9.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9018 -8.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1926 -9.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 8 1 0
11 12 1 0
12 15 1 0
14 13 1 0
13 11 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 20 1 6
19 21 2 0
16 22 2 0
17 23 1 1
23 24 1 0
6 25 1 0
11 26 1 6
12 2 1 6
2 27 1 0
27 28 2 0
24 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.49Molecular Weight (Monoisotopic): 434.1842AlogP: 2.68#Rotatable Bonds: 4Polar Surface Area: 99.10Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.98CX Basic pKa: 1.30CX LogP: 3.41CX LogD: 3.41Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 1.65
References 1. Aparicio-Cuevas MA, Rivero-Cruz I, Sánchez-Castellanos M, Menéndez D, Raja HA, Joseph-Nathan P, González MDC, Figueroa M.. (2017) Dioxomorpholines and Derivatives from a Marine-Facultative Aspergillus Species., 80 (8): [PMID:28796494 ] [10.1021/acs.jnatprod.7b00331 ]