7'-fluoro-1',3,3,3',3'-pentamethyl-6-(2-methylpyrimidin-5-yl)-1,6'-biindoline-2,2'-dione

ID: ALA4206265

PubChem CID: 129126909

Max Phase: Preclinical

Molecular Formula: C26H25FN4O2

Molecular Weight: 444.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2ccc3c(c2)N(c2ccc4c(c2F)N(C)C(=O)C4(C)C)C(=O)C3(C)C)cn1

Standard InChI:  InChI=1S/C26H25FN4O2/c1-14-28-12-16(13-29-14)15-7-8-17-20(11-15)31(24(33)25(17,2)3)19-10-9-18-22(21(19)27)30(6)23(32)26(18,4)5/h7-13H,1-6H3

Standard InChI Key:  CORRWZHCYFJMBA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   23.9998   -7.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2145   -6.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4245   -7.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0783   -1.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0824   -2.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7880   -1.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8894   -2.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8883   -3.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5963   -3.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5945   -2.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1821   -3.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4745   -3.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7669   -3.8451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7658   -4.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4782   -5.0722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1828   -4.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3031   -2.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3080   -3.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0923   -3.6901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5723   -3.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3895   -3.0161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0772   -4.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3605   -4.9024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3452   -5.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0583   -5.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7751   -4.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7590   -5.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0484   -6.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0312   -7.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3663   -6.2865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1661   -6.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4379   -7.7429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4902   -4.5306    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 18  2  0
 17 10  2  0
 10  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20  5  1  0
  5 17  1  0
 20 21  2  0
 22 23  2  0
 23 24  1  0
 24 28  2  0
 26 22  1  0
 19 22  1  0
 14 25  1  0
 26 27  2  0
 27 28  1  0
 28  2  1  0
  2 29  1  0
 29 30  1  0
 30 27  1  0
 30 31  1  0
 29 32  2  0
 26 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4206265

    ---

Associated Targets(non-human)

Slc29a1 Equilibrative nucleoside transporter 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.51Molecular Weight (Monoisotopic): 444.1962AlogP: 4.80#Rotatable Bonds: 2
Polar Surface Area: 66.40Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.22CX LogP: 4.28CX LogD: 4.28
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.46

References

1. Rosse G..  (2017)  Indolinone Inhibitors of ENT1 for the Treatment of Schizophrenia.,  (10): [PMID:29057039] [10.1021/acsmedchemlett.7b00378]

Source