The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl)methyl)-N,3-diphenyl-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxamide ID: ALA4206335
PubChem CID: 132491825
Max Phase: Preclinical
Molecular Formula: C29H27N7O2
Molecular Weight: 505.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2cc(Cn3nc(-c4ccccc4)c4c3CCN(C(=O)Nc3ccccc3)C4)nn2)cc1
Standard InChI: InChI=1S/C29H27N7O2/c1-38-25-14-12-24(13-15-25)35-18-23(31-33-35)19-36-27-16-17-34(29(37)30-22-10-6-3-7-11-22)20-26(27)28(32-36)21-8-4-2-5-9-21/h2-15,18H,16-17,19-20H2,1H3,(H,30,37)
Standard InChI Key: BZTYPMALAUYTBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
1.1271 -4.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1259 -5.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8404 -5.9536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5564 -5.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5536 -4.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8386 -4.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2661 -4.2954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9817 -4.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6943 -4.2900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9848 -5.5295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4084 -4.7023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4045 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6879 -3.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9074 -3.2150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1200 -3.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1164 -4.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9026 -4.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3894 -3.8819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1562 -5.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5998 -5.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8528 -6.7283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6598 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2134 -6.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9575 -5.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1654 -2.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9726 -2.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5847 -2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3014 -2.4112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1317 -1.6031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3108 -1.5161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0535 -2.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1334 -3.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8847 -3.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5544 -3.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4679 -2.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7164 -2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3070 -3.7624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3916 -4.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
9 13 1 0
11 16 1 0
15 12 1 0
12 13 1 0
15 16 2 0
14 15 1 0
16 17 1 0
17 18 2 0
18 14 1 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
14 25 1 0
25 26 1 0
27 28 1 0
26 27 2 0
28 29 1 0
29 30 2 0
30 26 1 0
28 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.58Molecular Weight (Monoisotopic): 505.2226AlogP: 4.78#Rotatable Bonds: 6Polar Surface Area: 90.10Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.39CX Basic pKa: 1.65CX LogP: 4.59CX LogD: 4.59Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: -1.94
References 1. Zhang S, Xu Z, Gao C, Ren QC, Chang L, Lv ZS, Feng LS.. (2017) Triazole derivatives and their anti-tubercular activity., 138 [PMID:28692915 ] [10.1016/j.ejmech.2017.06.051 ] 2. Sharma A, Agrahari AK, Rajkhowa S, Tiwari VK.. (2022) Emerging impact of triazoles as anti-tubercular agent., 238 [PMID:35597009 ] [10.1016/j.ejmech.2022.114454 ]