1-((1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl)methyl)-N,3-diphenyl-6,7-dihydro-1H-pyrazolo[4,3-c]pyridine-5(4H)-carboxamide

ID: ALA4206335

PubChem CID: 132491825

Max Phase: Preclinical

Molecular Formula: C29H27N7O2

Molecular Weight: 505.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2cc(Cn3nc(-c4ccccc4)c4c3CCN(C(=O)Nc3ccccc3)C4)nn2)cc1

Standard InChI:  InChI=1S/C29H27N7O2/c1-38-25-14-12-24(13-15-25)35-18-23(31-33-35)19-36-27-16-17-34(29(37)30-22-10-6-3-7-11-22)20-26(27)28(32-36)21-8-4-2-5-9-21/h2-15,18H,16-17,19-20H2,1H3,(H,30,37)

Standard InChI Key:  BZTYPMALAUYTBK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    1.1271   -4.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1259   -5.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8404   -5.9536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5564   -5.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5536   -4.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8386   -4.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2661   -4.2954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9817   -4.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6943   -4.2900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9848   -5.5295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4084   -4.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4045   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6879   -3.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9074   -3.2150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1200   -3.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1164   -4.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9026   -4.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3894   -3.8819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1562   -5.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5998   -5.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8528   -6.7283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6598   -6.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2134   -6.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9575   -5.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1654   -2.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9726   -2.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5847   -2.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3014   -2.4112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1317   -1.6031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3108   -1.5161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0535   -2.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1334   -3.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8847   -3.9081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5544   -3.4255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4679   -2.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7164   -2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3070   -3.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3916   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  1  0
  9 13  1  0
 11 16  1  0
 15 12  1  0
 12 13  1  0
 15 16  2  0
 14 15  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 25  1  0
 25 26  1  0
 27 28  1  0
 26 27  2  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 28 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4206335

    ---

Associated Targets(non-human)

panC Pantothenate synthetase (234 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.58Molecular Weight (Monoisotopic): 505.2226AlogP: 4.78#Rotatable Bonds: 6
Polar Surface Area: 90.10Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.39CX Basic pKa: 1.65CX LogP: 4.59CX LogD: 4.59
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.36Np Likeness Score: -1.94

References

1. Zhang S, Xu Z, Gao C, Ren QC, Chang L, Lv ZS, Feng LS..  (2017)  Triazole derivatives and their anti-tubercular activity.,  138  [PMID:28692915] [10.1016/j.ejmech.2017.06.051]
2. Sharma A, Agrahari AK, Rajkhowa S, Tiwari VK..  (2022)  Emerging impact of triazoles as anti-tubercular agent.,  238  [PMID:35597009] [10.1016/j.ejmech.2022.114454]

Source