The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 6-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-4-oxo-1,4-dihydroquinoline-2-carboxylate ID: ALA4206533
PubChem CID: 145978584
Max Phase: Preclinical
Molecular Formula: C19H13ClF3N3O4
Molecular Weight: 439.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(=O)c2cc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)ccc2[nH]1
Standard InChI: InChI=1S/C19H13ClF3N3O4/c1-30-17(28)15-8-16(27)11-6-9(3-5-14(11)26-15)24-18(29)25-10-2-4-13(20)12(7-10)19(21,22)23/h2-8H,1H3,(H,26,27)(H2,24,25,29)
Standard InChI Key: LORPJLDVRMGZNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
38.3323 -16.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3311 -17.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0392 -17.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0374 -15.8978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7460 -16.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7494 -17.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4578 -17.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1675 -17.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1641 -16.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4511 -15.8876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4600 -18.3460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8705 -15.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8680 -15.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.5795 -16.2929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.5820 -17.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6231 -17.5342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9157 -17.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2077 -17.5331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9164 -16.3079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5003 -17.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5057 -16.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7992 -15.8967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0902 -16.3048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0921 -17.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7993 -17.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8002 -15.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5084 -14.6718 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.0930 -14.6700 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.7925 -14.2596 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.3822 -15.8966 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
23 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.78Molecular Weight (Monoisotopic): 439.0547AlogP: 4.63#Rotatable Bonds: 3Polar Surface Area: 100.29Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.71CX Basic pKa: ┄CX LogP: 4.58CX LogD: 4.58Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.27
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]