The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4207229
PubChem CID: 11026625
Max Phase: Preclinical
Molecular Formula: C17H17NO11S
Molecular Weight: 443.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)O[C@@H]2[C@H]3OS(=O)(=O)O[C@H]3[C@]3(O)c4cc5c(c(O)c4C(=O)N[C@H]3[C@@H]2O1)OCO5
Standard InChI: InChI=1S/C17H17NO11S/c1-16(2)26-10-11(27-16)13-17(21,14-12(10)28-30(22,23)29-14)5-3-6-9(25-4-24-6)8(19)7(5)15(20)18-13/h3,10-14,19,21H,4H2,1-2H3,(H,18,20)/t10-,11+,12+,13-,14+,17-/m0/s1
Standard InChI Key: GOXGCXIPDLVQKN-UFZBQXAWSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
15.2542 -10.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5444 -11.1311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2588 -11.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8381 -8.9643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5521 -9.3771 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5510 -8.5539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8369 -11.5067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1270 -12.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8369 -13.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5468 -11.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1270 -11.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5468 -12.7449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4171 -13.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7155 -12.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7155 -11.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4171 -11.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9313 -12.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9313 -11.6677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8369 -13.9707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4484 -12.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4171 -13.9707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5468 -11.1105 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.1889 -11.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8410 -10.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5568 -10.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3777 -9.4633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2195 -10.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2777 -10.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2608 -11.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0445 -11.7957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0719 -10.4536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1328 -9.6866 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.9991 -10.7638 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.2567 -12.3404 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4919 -9.8930 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
8 11 1 0
9 8 1 0
10 7 1 0
11 7 1 0
12 10 1 0
13 8 2 0
24 7 1 0
29 10 1 0
14 15 2 0
28 25 1 0
15 16 1 0
16 11 2 0
17 14 1 0
18 15 1 0
19 9 2 0
20 18 1 0
21 13 1 0
10 22 1 1
9 12 1 0
14 13 1 0
17 20 1 0
7 23 1 6
24 25 1 0
25 26 1 0
26 5 1 0
5 27 1 0
27 24 1 0
28 29 1 0
29 30 1 0
30 2 1 0
2 31 1 0
31 28 1 0
25 32 1 1
24 33 1 1
29 34 1 6
28 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.39Molecular Weight (Monoisotopic): 443.0522AlogP: -1.02#Rotatable Bonds: ┄Polar Surface Area: 159.08Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.39CX Basic pKa: ┄CX LogP: 0.08CX LogD: 0.04Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: 1.34
References 1. Nair JJ, Wilhelm A, Bonnet SL, van Staden J.. (2017) Antibacterial constituents of the plant family Amaryllidaceae., 27 (22): [PMID:29033234 ] [10.1016/j.bmcl.2017.09.052 ]